Compilation tweaks for mingw

Allwmake.mingw

@@ -0,0 +1,76 @@
+#!/bin/sh
+#----------------------------------*-sh-*--------------------------------------
+# =========                 |
+# \\      /  F ield         | foam-extend: Open Source CFD
+#  \\    /   O peration     | Version:     3.2
+#   \\  /    A nd           | Web:         http://www.foam-extend.org
+#    \\/     M anipulation  | For copyright notice see file Copyright
+#------------------------------------------------------------------------------
+# License
+#     This file is part of foam-extend.
+#
+#     foam-extend is free software: you can redistribute it and/or modify it
+#     under the terms of the GNU General Public License as published by the
+#     Free Software Foundation, either version 3 of the License, or (at your
+#     option) any later version.
+#
+#     foam-extend is distributed in the hope that it will be useful, but
+#     WITHOUT ANY WARRANTY; without even the implied warranty of
+#     MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+#     General Public License for more details.
+#
+#     You should have received a copy of the GNU General Public License
+#     along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+#
+# Script
+#     Allwmake.mingw
+#
+# Description
+#     Top-level build script for use with MSYS shell for MinGW-based builds on Windows.
+#
+# Author:
+#     Cesare Guardino, Alstom Power Ltd., (2015)
+#
+#------------------------------------------------------------------------------
+
+cd ${0%/*} || exit 1    # run from this directory
+
+echo
+echo "======================== FOAM-EXTEND MINGW WINDOWS TOP-LEVEL BUILD SCRIPT ========================"
+
+if [ "$PWD" != "$WM_PROJECT_DIR" ]
+then
+    echo "Error: Current directory is not \$WM_PROJECT_DIR"
+    echo "    The environment variable are not consistent with the installation."
+    echo "    Check the OpenFOAM entries in your dot-files and source them."
+    exit 1
+fi
+
+cd $WM_PROJECT_DIR/ThirdParty/mingwBuild
+echo
+echo "In directory `pwd`"
+echo "Configuring your OpenMPI installation ..."
+./configure_OpenMPI.sh
+PACKAGES_DIR=$WM_PROJECT_DIR/ThirdParty/packages
+if [ -d $PACKAGES_DIR ] ; then
+    echo "Third-party dependencies packages $PACKAGES_DIR already exists."
+else
+    echo "Building third-party dependencies ... (see `pwd`/build.log)"
+    ./build.sh > build.log 2>&1
+    echo "Installing third-party dependencies ..."
+    rm -rf $PACKAGES_DIR
+    mv x64/install $PACKAGES_DIR
+fi
+
+cd $WM_PROJECT_DIR
+echo
+echo "In directory `pwd`"
+echo "Build foam-extend ... (see `pwd`/Allwmake.log)"
+./Allwmake > Allwmake.log 2>&1
+echo "Copying MinGW dependencies to $FOAM_APPBIN ..."
+cp -p $MINGW_HOME/bin/libgcc_s_seh-1.dll $FOAM_APPBIN
+cp -p $MINGW_HOME/bin/libstdc++-6.dll $FOAM_APPBIN
+cp -p $MINGW_HOME/bin/libwinpthread-1.dll $FOAM_APPBIN
+
+echo
+echo "All done!"

ThirdParty/mingwBuild/build.sh

@@ -0,0 +1,293 @@
+#!/bin/sh
+#------------------------------------------------------------------------------
+# =========                 |
+# \\      /  F ield         | foam-extend: Open Source CFD
+#  \\    /   O peration     | Version:     3.2
+#   \\  /    A nd           | Web:         http://www.foam-extend.org
+#    \\/     M anipulation  | For copyright notice see file Copyright
+#------------------------------------------------------------------------------
+# License
+#     This file is part of foam-extend.
+#
+#     foam-extend is free software: you can redistribute it and/or modify it
+#     under the terms of the GNU General Public License as published by the
+#     Free Software Foundation, either version 3 of the License, or (at your
+#     option) any later version.
+#
+#     foam-extend is distributed in the hope that it will be useful, but
+#     WITHOUT ANY WARRANTY; without even the implied warranty of
+#     MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+#     General Public License for more details.
+#
+#     You should have received a copy of the GNU General Public License
+#     along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+#
+# Script
+#     build.sh
+#
+# Description
+#     Downloads, extracts, builds and installs thirdy-party dependencies.
+#
+# Author:
+#     Cesare Guardino, Alstom Power Ltd., (2015)
+#
+#------------------------------------------------------------------------------
+
+# {{{ DEFINE UTILITY FUNCTIONS
+download() {
+    file=$1
+    url=$2
+
+    if [ -f $BUILD_HOME/downloads/$file ] ; then
+        echo "Using already existing file $BUILD_HOME/downloads/$file"
+    else
+        wget --no-check-certificate $url -O $BUILD_HOME/downloads/$file
+    fi
+}
+
+extract() {
+    file=$1
+    program=$2
+
+    cp -p $BUILD_HOME/downloads/$file .
+    package=`basename $file`
+    if [ "$program" = "7zip" ] ; then
+        "$ZIP_EXE" x $package
+    else
+        $program -cd $package | tar xvf -
+    fi
+    rm $package
+}
+
+unzip_dir() {
+    dir=$1
+
+    mkdir $dir
+    cd $dir
+    extract $dir.zip 7zip
+    cd ..
+}
+
+patch() {
+    dir=$1
+
+    cp -rp $BUILD_HOME/$ARCH/patches/$dir .
+}
+
+mkchk() {
+    dir=$1
+
+    if [ ! -d $dir ] ; then
+        mkdir $dir
+    fi
+}
+
+mkdel() {
+    dir=$1
+
+    rm -rf $dir > /dev/null 2>&1
+    mkdir $dir
+}
+# }}}
+
+# {{{ DEFINE PROCESS FUNCTIONS
+start() {
+    echo "======================== FOAM-EXTEND THIRD-PARTY DEPENDENCIES WINDOWS BUILD SCRIPT ========================"
+}
+
+initialise() {
+    echo ""
+
+    if [ ! "$MINGW_HOME" ] ; then
+        echo "*** ERROR: MINGW_HOME environment variable not specified."
+        exit 1
+    else
+        echo "Using MINGW_HOME=$MINGW_HOME"
+    fi
+
+    BUILD_HOME=`pwd`
+    ZIP_EXE="7z.exe"
+    ARCH="x64"
+
+    BUILD_DIR=$BUILD_HOME/$ARCH/build
+    INSTALL_DIR=$BUILD_HOME/$ARCH/install
+    OUT_DIR=$BUILD_HOME/$ARCH/output
+
+    mkchk $BUILD_HOME/downloads
+
+    echo ""
+    echo "All stdout/stderr output is redirected to the directory $OUT_DIR"
+    echo "All builds occur in the directory $BUILD_DIR"
+    echo "The script will install the completed builds in the directory $INSTALL_DIR"
+}
+
+cleanup() {
+    echo ""
+    echo "Removing previous builds ..."
+
+    mkdel $BUILD_DIR
+    mkdel $INSTALL_DIR
+    mkdel $OUT_DIR
+}
+
+build_library() {
+    PACKAGE=$1
+
+    echo "- Building $PACKAGE ..."
+    LOG_FILE=$OUT_DIR/$PACKAGE.log
+    cd $BUILD_DIR
+
+    case $PACKAGE in
+
+        dlfcn-win32-master)
+            download $PACKAGE.zip https://github.com/dlfcn-win32/dlfcn-win32/archive/master.zip > $LOG_FILE 2>&1
+            extract $PACKAGE.zip 7zip >> $LOG_FILE 2>&1
+            cd $PACKAGE
+            ./configure --prefix=$INSTALL_DIR/system >> $LOG_FILE 2>&1
+            make >> $LOG_FILE 2>&1
+            mkdir $INSTALL_DIR/system
+            make install >> $LOG_FILE 2>&1
+            ;;
+
+        system)
+            cd $INSTALL_DIR
+            patch system
+            ;;
+
+        pthreads-w32-2-9-1-release)
+            download $PACKAGE.zip ftp://sourceware.org/pub/pthreads-win32/pthreads-w32-2-9-1-release.zip > $LOG_FILE 2>&1
+            unzip_dir $PACKAGE >> $LOG_FILE 2>&1
+            patch $PACKAGE
+            ;;
+
+        metis-5.1.0)
+            download $PACKAGE.tar.gz http://glaros.dtc.umn.edu/gkhome/fetch/sw/metis/$PACKAGE.tar.gz > $LOG_FILE 2>&1
+            extract "$PACKAGE.tar.gz" gzip >> $LOG_FILE 2>&1
+            patch $PACKAGE
+            cd $PACKAGE
+            mkdir build/windows
+            cd build/windows
+            cmake -G "MSYS Makefiles" -DCMAKE_CONFIGURATION-TYPES="Release" -DGKLIB_PATH="../../GKlib" ../.. >> $LOG_FILE 2>&1
+            make >> $LOG_FILE 2>&1
+            mkdir $INSTALL_DIR/$PACKAGE
+            mkdir $INSTALL_DIR/$PACKAGE/bin
+            mkdir $INSTALL_DIR/$PACKAGE/include
+            mkdir $INSTALL_DIR/$PACKAGE/lib
+            cp -p programs/*.exe $INSTALL_DIR/$PACKAGE/bin
+            cp -p ../../include/metis.h $INSTALL_DIR/$PACKAGE/include
+            cp -p libmetis/libmetis.a $INSTALL_DIR/$PACKAGE/lib
+            ;;
+
+        parmetis-4.0.3)
+            download $PACKAGE.tar.gz http://glaros.dtc.umn.edu/gkhome/fetch/sw/parmetis/$PACKAGE.tar.gz > $LOG_FILE 2>&1
+            extract "$PACKAGE.tar.gz" gzip >> $LOG_FILE 2>&1
+            patch $PACKAGE
+            cd $PACKAGE
+            mkdir build/windows
+            cd build/windows
+            cmake -G "MSYS Makefiles" -DCMAKE_CONFIGURATION-TYPES="Release" -DGKLIB_PATH="../../metis/GKlib" ../.. >> $LOG_FILE 2>&1
+            $BUILD_HOME/parmetis_includes_hack.pl
+            make >> $LOG_FILE 2>&1
+            mkdir $INSTALL_DIR/$PACKAGE
+            mkdir $INSTALL_DIR/$PACKAGE/bin
+            mkdir $INSTALL_DIR/$PACKAGE/include
+            mkdir $INSTALL_DIR/$PACKAGE/lib
+            cp -p programs/*.exe $INSTALL_DIR/$PACKAGE/bin
+            cp -p ../../metis/include/metis.h $INSTALL_DIR/$PACKAGE/include
+            cp -p ../../include/parmetis.h $INSTALL_DIR/$PACKAGE/include
+            cp -p libmetis/libmetis.a $INSTALL_DIR/$PACKAGE/lib
+            cp -p libparmetis/libparmetis.a $INSTALL_DIR/$PACKAGE/lib
+            ;;
+
+        ParMGridGen-1.0)
+            export EXTRA_SYSTEM_HOME=$INSTALL_DIR/system
+            download $PACKAGE.tar.gz http://www.mgnet.org/mgnet/Codes/parmgridgen/$PACKAGE.tar.gz > $LOG_FILE 2>&1
+            extract "$PACKAGE.tar.gz" gzip >> $LOG_FILE 2>&1
+            patch $PACKAGE
+            cd $PACKAGE
+            make serial   >> $LOG_FILE 2>&1
+            make parallel >> $LOG_FILE 2>&1
+            mkdir $INSTALL_DIR/$PACKAGE
+            mkdir $INSTALL_DIR/$PACKAGE/bin
+            mkdir $INSTALL_DIR/$PACKAGE/include
+            mkdir $INSTALL_DIR/$PACKAGE/lib
+            cp -p *.exe $INSTALL_DIR/$PACKAGE/bin
+            cp -p libmgrid.a $INSTALL_DIR/$PACKAGE/lib
+            cp -p libparmgrid.a $INSTALL_DIR/$PACKAGE/lib
+            cp -p MGridGen/IMlib/libIMlib.a $INSTALL_DIR/$PACKAGE/lib
+            cp -p ParMGridGen/IMParMetis-2.0/libIMparmetis.a $INSTALL_DIR/$PACKAGE/lib
+            cp -p MGridGen/IMlib/*.h $INSTALL_DIR/$PACKAGE/include
+            cp -p MGridGen/Lib/*.h $INSTALL_DIR/$PACKAGE/include
+            export EXTRA_SYSTEM_HOME=
+            ;;
+
+        scotch_6.0.0)
+            export PTHREADS_HOME=$BUILD_DIR/pthreads-w32-2-9-1-release
+            download $PACKAGE.tar.gz https://gforge.inria.fr/frs/download.php/31831 > $LOG_FILE 2>&1
+            extract "$PACKAGE.tar.gz" gzip >> $LOG_FILE 2>&1
+            patch $PACKAGE
+            cd $PACKAGE/src
+            make scotch   >> $LOG_FILE 2>&1
+            make ptscotch >> $LOG_FILE 2>&1
+            mkdir $INSTALL_DIR/$PACKAGE
+            make install prefix=$INSTALL_DIR/$PACKAGE >> $PACKAGE.log 2>&1
+            export PTHREADS_HOME=
+            ;;
+
+        mesquite-2.1.2)
+            export CPPFLAGS=-fpermissive
+            download $PACKAGE.tar.gz http://downloads.sourceforge.net/project/openfoam-extend/foam-extend-3.0/ThirdParty/$PACKAGE.tar.gz > $LOG_FILE 2>&1
+            extract "$PACKAGE.tar.gz" gzip >> $LOG_FILE 2>&1
+            cd $PACKAGE
+            cp -p $MINGW_HOME/bin/libstdc++-6.dll utils
+            ./configure --prefix=$INSTALL_DIR >> $LOG_FILE 2>&1
+            make >> $LOG_FILE 2>&1
+            mkdir $INSTALL_DIR/$PACKAGE
+            make install prefix=$INSTALL_DIR/$PACKAGE >> $LOG_FILE 2>&1
+            export CPPFLAGS=
+            ;;
+
+        *)
+            echo "*** ERROR: Unknown package '$PACKAGE'"
+            exit 1
+            ;;
+    esac
+}
+
+build_libraries() {
+    echo ""
+    echo "Building libraries ..."
+    build_library dlfcn-win32-master
+    build_library system
+    build_library pthreads-w32-2-9-1-release
+    build_library metis-5.1.0
+    build_library parmetis-4.0.3
+    build_library ParMGridGen-1.0
+    build_library scotch_6.0.0
+    build_library mesquite-2.1.2
+}
+
+create_dirs() {
+    echo ""
+    echo "Checking for build directories and creating them if required ..."
+
+    mkchk $BUILD_DIR
+    mkchk $INSTALL_DIR
+    mkchk $OUT_DIR
+}
+
+finish() {
+    echo ""
+    echo "All done!"
+}
+# }}}
+
+# {{{ MAIN EXECUTION
+cd ${0%/*} || exit 1    # run from this directory
+start
+initialise
+mkchk $ARCH
+cleanup
+build_libraries
+finish
+# }}}

ThirdParty/mingwBuild/clean.sh

@@ -0,0 +1,82 @@
+#!/bin/sh
+#------------------------------------------------------------------------------
+# =========                 |
+# \\      /  F ield         | foam-extend: Open Source CFD
+#  \\    /   O peration     | Version:     3.2
+#   \\  /    A nd           | Web:         http://www.foam-extend.org
+#    \\/     M anipulation  | For copyright notice see file Copyright
+#------------------------------------------------------------------------------
+# License
+#     This file is part of foam-extend.
+#
+#     foam-extend is free software: you can redistribute it and/or modify it
+#     under the terms of the GNU General Public License as published by the
+#     Free Software Foundation, either version 3 of the License, or (at your
+#     option) any later version.
+#
+#     foam-extend is distributed in the hope that it will be useful, but
+#     WITHOUT ANY WARRANTY; without even the implied warranty of
+#     MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+#     General Public License for more details.
+#
+#     You should have received a copy of the GNU General Public License
+#     along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+#
+# Script
+#     build.sh
+#
+# Description
+#     Removes previous thirdy-party dependencies build directories (does not remove installed packages directory)
+#
+# Author:
+#     Cesare Guardino, Alstom Power Ltd., (2015)
+#
+#------------------------------------------------------------------------------
+
+# {{{ DEFINE UTILITY FUNCTIONS
+remove_dir() {
+    dir=$1
+
+    rm -rf $dir > /dev/null 2>&1
+}
+# }}}
+
+# {{{ DEFINE PROCESS FUNCTIONS
+start() {
+    echo "======================== FOAM-EXTEND THIRD-PARTY DEPENDENCIES WINDOWS CLEAN SCRIPT ========================"
+}
+
+initialise() {
+    echo ""
+
+    BUILD_HOME=`pwd`
+    ARCH="x64"
+
+    BUILD_DIR=$BUILD_HOME/$ARCH/build
+    INSTALL_DIR=$BUILD_HOME/$ARCH/install
+    OUT_DIR=$BUILD_HOME/$ARCH/output
+}
+
+cleanup() {
+    echo ""
+    echo "Removing previous builds ..."
+
+    remove_dir $BUILD_DIR
+    remove_dir $INSTALL_DIR
+    remove_dir $OUT_DIR
+    remove_dir $BUILD_HOME/downloads
+}
+
+finish() {
+    echo ""
+    echo "All done!"
+}
+# }}}
+
+# {{{ MAIN EXECUTION
+cd ${0%/*} || exit 1    # run from this directory
+start
+initialise
+cleanup
+finish
+# }}}

ThirdParty/mingwBuild/configure_OpenMPI.sh

@@ -0,0 +1,67 @@
+#!/bin/sh
+#------------------------------------------------------------------------------
+# =========                 |
+# \\      /  F ield         | foam-extend: Open Source CFD
+#  \\    /   O peration     | Version:     3.2
+#   \\  /    A nd           | Web:         http://www.foam-extend.org
+#    \\/     M anipulation  | For copyright notice see file Copyright
+#------------------------------------------------------------------------------
+# License
+#     This file is part of foam-extend.
+#
+#     foam-extend is free software: you can redistribute it and/or modify it
+#     under the terms of the GNU General Public License as published by the
+#     Free Software Foundation, either version 3 of the License, or (at your
+#     option) any later version.
+#
+#     foam-extend is distributed in the hope that it will be useful, but
+#     WITHOUT ANY WARRANTY; without even the implied warranty of
+#     MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+#     General Public License for more details.
+#
+#     You should have received a copy of the GNU General Public License
+#     along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+#
+# Script
+#     configure_OpenMPI.sh
+#
+# Description
+#     Generates static OpenMPI library to enable compilation with MINGW toolchain.
+#
+# Author:
+#     Cesare Guardino, Alstom Power Ltd., (2015)
+#
+#------------------------------------------------------------------------------
+
+if [ -f "$MPI_ROOTDIR/lib/libmpi.a" ] ; then
+    echo "$MPI_ROOTDIR/lib/libmpi.a already exists."
+    exit 1
+fi
+
+INSTALL=1
+if [ $1 ] ; then
+    if [ $1 = "--no-install" ] ; then
+        INSTALL=0
+        echo "*** WARNING: Will not install exported libmpi.a and libmpi.def"
+    fi
+fi
+
+tmp=`echo $RANDOM$RANDOM$RANDOM`
+current_dir=`pwd`
+mkdir -p /tmp/$tmp
+cd /tmp/$tmp
+
+pexports $MPI_ROOTDIR/bin/libmpi.dll > libmpi.def
+dlltool --dllname libmpi.dll --def libmpi.def --output-lib libmpi.a
+
+if [ $INSTALL -eq 1 ] ; then
+    mv libmpi.a $MPI_ROOTDIR/lib
+    mv libmpi.def $MPI_ROOTDIR/lib
+    cd $current_dir
+    rm -rf /tmp/$tmp
+    echo "Installed exported libraries into $MPI_ROOTDIR/lib"
+else
+    cd $current_dir
+    echo "Exported libraries left in directory /tmp/$tmp"
+fi
+

ThirdParty/mingwBuild/parmetis_includes_hack.pl

@@ -0,0 +1,70 @@
+#!/usr/bin/perl
+#------------------------------------------------------------------------------
+# =========                 |
+# \\      /  F ield         | foam-extend: Open Source CFD
+#  \\    /   O peration     | Version:     3.2
+#   \\  /    A nd           | Web:         http://www.foam-extend.org
+#    \\/     M anipulation  | For copyright notice see file Copyright
+#------------------------------------------------------------------------------
+# License
+#     This file is part of foam-extend.
+#
+#     foam-extend is free software: you can redistribute it and/or modify it
+#     under the terms of the GNU General Public License as published by the
+#     Free Software Foundation, either version 3 of the License, or (at your
+#     option) any later version.
+#
+#     foam-extend is distributed in the hope that it will be useful, but
+#     WITHOUT ANY WARRANTY; without even the implied warranty of
+#     MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+#     General Public License for more details.
+#
+#     You should have received a copy of the GNU General Public License
+#     along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+#
+# Script
+#     parmetis_includes_hack.pl
+#
+# Description
+#     Adds OpenMPI lib/includes dirs to CMake-generated GCC options.
+#
+# Author:
+#     Cesare Guardino, Alstom Power Ltd., (2015)
+#
+#------------------------------------------------------------------------------
+
+use strict;
+use warnings;
+
+use File::Find;
+
+my $MPI_ROOTDIR = $ENV{"MPI_ROOTDIR"};
+$MPI_ROOTDIR =~ s/^\/\w//;
+my $drive_letter = $&;
+$drive_letter =~ s/\///;
+$MPI_ROOTDIR = uc($drive_letter) . ":" . $MPI_ROOTDIR;
+
+my @dirs = (".");
+find(\&wanted, @dirs);
+
+sub wanted
+{
+    my $file = $_;
+    my $path = $File::Find::name;
+
+    if ($file eq "linklibs.rsp" or $file eq "includes_C.rsp")
+    {
+        open (FILE, '<', $file) or die ("ERROR: Can't open '$path' [$!]");
+        my @contents = <FILE>;
+        close (FILE);
+
+        my $string = ($file eq "linklibs.rsp") ? "-L$MPI_ROOTDIR/lib -lmpi" : "-I$MPI_ROOTDIR/include";
+        open (FILE, '>', $file) or die ("ERROR: Can't open '$path' [$!]");
+        foreach my $line (@contents)
+        {
+            chomp($line);
+            print FILE $line . $string;
+        }
+        close (FILE);        
+    }
+}

ThirdParty/mingwBuild/x64/patches/ParMGridGen-1.0/MGridGen/IMlib/IMlib.h

@@ -0,0 +1,285 @@
+/*
+ * IMlib.h
+ * 
+ * Irene's library of most frequently used routines
+ *
+ */
+
+#ifndef _IMLIB_H_
+#define _IMLIB_H_
+
+
+/* Undefine the following #define in order to use short int as the idxtype */
+#define IDXTYPE_INT
+/* Undefine the following #define in order to use float as the realtype */
+/*#define TYPE_REAL*/
+
+/* Indexes are as long as integers for now */
+#ifdef IDXTYPE_INT
+typedef int idxtype;
+#else
+typedef short idxtype;
+#endif
+
+/* floats for now */
+#ifdef TYPE_REAL
+typedef float realtype;
+#else
+typedef double realtype;
+#endif
+
+
+/*************************************************************************
+* Header file inclusion section
+**************************************************************************/
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <ctype.h>
+#include <math.h>
+#include <stdarg.h>
+#include <time.h>
+#include "rand48.h"
+
+#ifdef DMALLOC
+#include <dmalloc.h>
+#else
+#include <malloc.h>
+#endif
+
+/*************************************************************************
+* Data structure definition section
+**************************************************************************/
+/*-------------------------------------------------------------
+ * The following data structure stores int key-value pairs
+ *-------------------------------------------------------------*/
+struct IKeyValueType {
+  int key;
+  int val;
+};
+
+typedef struct IKeyValueType IKeyValueType;
+
+
+/*-------------------------------------------------------------
+ * The following data structure stores int key-value pairs
+ *-------------------------------------------------------------*/
+struct idxKeyValueType {
+  idxtype key;
+  idxtype val;
+};
+
+typedef struct idxKeyValueType idxKeyValueType;
+
+
+/*-------------------------------------------------------------
+ * The following data structure stores int-key - double-value pairs
+ *-------------------------------------------------------------*/
+struct FKeyValueType {
+  double key;
+  int val, val1, val2;
+};
+
+typedef struct FKeyValueType FKeyValueType;
+
+
+/*-------------------------------------------------------------
+ * The following data structure stores int-key - double-value pairs
+ *-------------------------------------------------------------*/
+struct realKeyValueType {
+  realtype key;
+  int val, val1, val2;
+};
+
+typedef struct realKeyValueType realKeyValueType;
+
+/*************************************************************************
+* Definition Section
+**************************************************************************/
+#define LTERM                   (void **) 0     /* List terminator for IMfree() */
+
+
+
+/*************************************************************************
+* Macros Section
+**************************************************************************/
+/*-------------------------------------------------------------
+ * Usefull commands 
+ *-------------------------------------------------------------*/
+#define sign(a, b) ((b) >= 0 ? ((a) >= 0.0 ? a : -a) : ((a) >= 0.0 ? -a : a))
+#define amax(a, b) ((a) >= (b) ? (a) : (b))
+#define amin(a, b) ((a) >= (b) ? (b) : (a))
+#define RandomInRange(u) ((int)(drand48()*((double)(u))))
+#define RandomInRangeFast(u) ((rand()>>3)%(u))
+#define SWAP(a, b, tmp) do {(tmp) = (a); (a) = (b); (b) = (tmp);} while(0) 
+#define INC_DEC(a, b, val) do {(a) += (val); (b) -= (val);} while(0)
+#define icopy(n, a, b) (int *)memcpy((void *)(b), (void *)(a), sizeof(int)*(n)) 
+#define idxcopy(n, a, b) (idxtype *)memcpy((void *)(b), (void *)(a), sizeof(idxtype)*(n))
+#define scopy(n, a, b) (double *)memcpy((void *)(b), (void *)(a), sizeof(double)*(n))
+#define fcopy(n, a, b) (double *)memcpy((void *)(b), (void *)(a), sizeof(double)*(n))
+#define realcopy(n, a, b) (realtype *)memcpy((void *)(b), (void *)(a), sizeof(realtype)*(n))
+
+
+/*-------------------------------------------------------------
+ * Timing macros
+ *-------------------------------------------------------------*/
+#define cleartimer(tmr) (tmr = 0.0)
+#define starttimer(tmr) (tmr -= seconds())
+#define stoptimer(tmr) (tmr += seconds())
+#define gettimer(tmr) (tmr)
+
+ 
+/*-------------------------------------------------------------
+ * Debuging memory leaks
+ *-------------------------------------------------------------*/
+#ifdef DMALLOC
+#define imalloc(n, msg) (malloc(sizeof(int)*(n)))
+#define fmalloc(n, msg) (malloc(sizeof(double)*(n)))
+#define idxmalloc(n, msg) ((idxtype *)malloc(sizeof(idxtype)*(n)))
+#define realmalloc(n, msg) ((realtype *)malloc(sizeof(realtype)*(n)))
+#define ismalloc(n, val, msg) (iset((n), (val), malloc(sizeof(int)*(n))))
+#define idxsmalloc(n, val, msg) (idxset((n), (val), (idxtype *)malloc(sizeof(idxtype)*(n))))
+#define fsmalloc(n, val, msg) (fset((n), (val), malloc(sizeof(double)*(n))))
+#define realsmalloc(n, val, msg) (realset((n), (val), (realtype *)malloc(sizeof(realtype)*(n))))
+#define IMmalloc(a, b) (malloc((a)))
+#endif
+
+#ifdef DMALLOC
+#   define MALLOC_CHECK(ptr)                                          \
+    if (malloc_verify((ptr)) == DMALLOC_VERIFY_ERROR) {  \
+        printf("***MALLOC_CHECK failed on line %d of file %s: " #ptr "\n", \
+              __LINE__, __FILE__);                               \
+        abort();                                                \
+    }
+#else
+#   define MALLOC_CHECK(ptr) ;
+#endif 
+
+
+/*-------------------------------------------------------------
+ * CSR conversion macros
+ *-------------------------------------------------------------*/
+#define MAKECSR(i, n, a) \
+   do { \
+     for (i=1; i<n; i++) a[i] += a[i-1]; \
+     for (i=n; i>0; i--) a[i] = a[i-1]; \
+     a[0] = 0; \
+   } while(0) 
+
+
+/*-------------------------------------------------------------
+ * Program Assertions
+ *-------------------------------------------------------------*/
+#ifdef DEBUG
+#   define ASSERT(expr)                                          \
+    if (!(expr)) {                                               \
+        printf("***ASSERTION failed on line %d of file %s: " #expr "\n", \
+              __LINE__, __FILE__);                               \
+        abort();                                                \
+    }
+#else
+#   define ASSERT(expr) ;
+#endif 
+
+#ifdef DEBUG
+#   define ASSERTP(expr,msg)                                          \
+    if (!(expr)) {                                               \
+        printf("***ASSERTION failed on line %d of file %s: " #expr "\n", \
+              __LINE__, __FILE__);                               \
+        printf msg ; \
+        printf("\n"); \
+        abort();                                                \
+    }
+#else
+#   define ASSERTP(expr,msg) ;
+#endif 
+
+
+/*************************************************************************
+* Function prototypes
+**************************************************************************/
+/*-------------------------------------------------------------
+ * blas.c
+ *-------------------------------------------------------------*/
+int *iset(int, int, int *);
+idxtype *idxset(int, idxtype, idxtype *);
+double *fset(int, double, double *);
+realtype *realset(int, realtype, realtype *);
+int iamax(int, int *);
+int idxamax(int, idxtype *);
+int famax(int, double *);
+int iamin(int, int *);
+int idxamin(int, idxtype *);
+int famin(int, double *);
+int charsum(int, char *);
+int isum(int, int *);
+int idxsum(int, idxtype *);
+double ssum(int, double *);
+double ssum_strd(int, double *, int);
+void sscale(int, double, double *);
+double snorm2(int, double *);
+double sdot(int, double *, double *);
+void saxpy(int, double, double *, int, double *, int);
+
+
+/*-------------------------------------------------------------
+ * file.c
+ *-------------------------------------------------------------*/
+FILE *IMfopen(char *, char *, char *);
+void IMfclose(FILE *);
+
+/*-------------------------------------------------------------
+ * memory.c
+ *-------------------------------------------------------------*/
+#ifndef DMALLOC
+int *imalloc(int, char *);
+idxtype *idxmalloc(int, char *);
+double *fmalloc(int, char *);
+realtype *realmalloc(int, char *);
+int *ismalloc(int, int, char *);
+idxtype *idxsmalloc(int, idxtype, char *);
+double *fsmalloc(int, double, char *);
+realtype *realsmalloc(int, realtype, char *);
+void *IMmalloc(int, char *);
+#endif
+/* void IMfree(void **, ...); */
+
+
+/*-------------------------------------------------------------
+ * util.c
+ *-------------------------------------------------------------*/
+void *errexit(char *,...);
+int IMlog2(int);
+double flog2(double);
+int ispow2(int);
+double seconds(void);
+
+
+/*-------------------------------------------------------------
+ * Sorting routines
+ *-------------------------------------------------------------*/
+void dfkeysort(int, FKeyValueType *);
+void dkeysort(int, IKeyValueType *);
+void ifkeysort(int, FKeyValueType *);
+void ifkeysort2(int, FKeyValueType *);
+void ifloatsort(int, double *);
+void iintsort(int, int *);
+void ikeysort(int, IKeyValueType *);
+void idxkeysort(int, idxKeyValueType *);
+void ikeysort2(int, IKeyValueType *);
+void idxkeysort2(int, idxKeyValueType *);
+
+/*-------------------------------------------------------------
+ * sort.c 
+ *-------------------------------------------------------------*/
+void ikeyvalsort_org(int, IKeyValueType *);
+int IncKeyValueCmp(const void *, const void *);
+void dkeyvalsort(int, IKeyValueType *);
+void BucketSortKeysInc(int, idxtype, idxtype *, int *, int *);
+int DecKeyValueCmp(const void *, const void *);
+int BSearch(int, idxtype *, int);
+void RandomPermute(int, idxtype *, int);
+void RandomPermuteFine(int, int *, int);
+void FastRandomPermute(int, idxtype *, int);
+
+#endif

ThirdParty/mingwBuild/x64/patches/ParMGridGen-1.0/MGridGen/Lib/mgridgen.c

@@ -0,0 +1,111 @@
+/*
+ * Copyright 2001, Regents of the University of Minnesota
+ *
+ * mgridgen.c
+ *
+ * This file contains the top level routines for the sparse hierarchical
+ * clustering algorithm.
+ *
+ * George Irene
+ */
+
+#include "mgridgen.h"
+#include "rand48.h"
+
+
+/*************************************************************************
+* This function is the entry point for the SHCluster() routine.
+**************************************************************************/
+void MGridGen(int nvtxs, idxtype *xadj, realtype *vvol, realtype *vsurf,
+              idxtype *adjncy, realtype *adjwgt, int minsize, int maxsize,
+              int *options, int *nmoves, int *nparts, idxtype *part)
+{
+  GraphType graph;
+  CtrlType ctrl;
+
+  srand(4321);
+  srand48(7654321L);
+
+  /*------------------------------------------------------------
+   * Set up the various control structures 
+   *------------------------------------------------------------*/
+  ctrl.CType = options[OPTION_CTYPE];
+  ctrl.RType = options[OPTION_RTYPE];
+  ctrl.dbglvl = options[OPTION_DBGLVL];
+  ctrl.dim = options[OPTION_DIM];
+  ctrl.minsize = minsize;
+  ctrl.maxsize = maxsize;
+  ctrl.nparts = -1;
+
+  /*------------------------------------------------------------
+   * Set up the graph
+   *------------------------------------------------------------*/
+  SetUpGraph(&graph, nvtxs, xadj, vvol, vsurf, adjncy, adjwgt);
+
+  CreateGrid(&ctrl, &graph);
+
+  *nparts = ctrl.nparts;
+  icopy(nvtxs, graph.where, part);
+  *nmoves = graph.nmoves;
+
+  FreeGraph(&graph);
+}
+
+
+/*************************************************************************
+* This function is the entry point for performing refinement
+**************************************************************************/
+void MGridGenRefine(int nvtxs, idxtype *xadj, realtype *vvol, realtype *vsurf,
+                    idxtype *adjncy, idxtype *fusedinfo, realtype *adjwgt,
+                    int minsize, int maxsize, int *options, int *nmoves,
+                    int *nparts, idxtype *part)
+{
+  int i;
+  GraphType graph;
+  CtrlType ctrl;
+
+  srand(4321);
+  srand48(7654321L);
+
+  /*------------------------------------------------------------
+   * Set up the various control structures 
+   *------------------------------------------------------------*/
+  ctrl.CType = options[OPTION_CTYPE];
+  ctrl.RType = options[OPTION_RTYPE];
+  ctrl.dbglvl = options[OPTION_DBGLVL];
+  ctrl.dim = options[OPTION_DIM];
+  ctrl.minsize = minsize;
+  ctrl.maxsize = maxsize;
+  ctrl.nparts = -1;
+
+  /*------------------------------------------------------------
+   * Set up the graph
+   *------------------------------------------------------------*/
+  SetUpGraph(&graph, nvtxs, xadj, vvol, vsurf, adjncy, adjwgt);
+  graph.cmap = NULL;
+
+  graph.where = idxmalloc(graph.nvtxs, "graph.where");
+  for (i=0; i<graph.nvtxs; i++)
+    graph.where[i] = fusedinfo[i];
+
+  RefineKWayOnce(&ctrl, &graph, 10);
+
+  *nparts = ctrl.nparts;
+  icopy(nvtxs, graph.where, part);
+  *nmoves = graph.nmoves;
+
+  FreeGraph(&graph);
+}
+
+
+/*************************************************************************
+* This function creates the coarse grid
+**************************************************************************/
+void CreateGrid(CtrlType *ctrl, GraphType *graph)
+{
+  GraphType *cgraph;
+
+  cgraph = Coarsen(ctrl, graph);
+
+  RefineKWay(ctrl, graph, cgraph, 10);
+}

ThirdParty/mingwBuild/x64/patches/ParMGridGen-1.0/Makefile.in

@@ -0,0 +1,64 @@
+#--------------------------------------------------------------------------
+# Which make to use 
+make = gmake
+
+# Which compiler to use
+#  CC is the compiler for the serial code
+#  PARCC is the compiter for the parallel code
+CC = gcc
+PARCC = gcc
+
+# What optimization level to use
+OPTFLAGS = -O3
+
+# What options to be used by the compiler
+COPTIONS = 
+
+# Which loader to use
+LD = gcc
+PARLD = gcc
+
+# What options to be used by the loader
+LDOPTIONS = -O3
+
+# Where to put the executable 
+BINDIR = ../..
+
+# Additional libraries
+DMALLOCDIR = /usr/local
+IMLIBDIR = ../../MGridGen/IMlib
+
+# Include directories for the compiler
+INCDIR = -I$(MPI_ROOTDIR)/include -I$(EXTRA_SYSTEM_HOME)/include
+
+# In which directories to look for any additional libraries
+LIBDIR = -L../.. \
+         -L$(MPI_ROOTDIR)/lib
+
+# Set some flags
+DEBUGFLAGS =
+
+# What additional libraries to link the programs with (eg., -lmpi)
+LIBS = -lmgrid -lm
+PARLIBS = -lparmgrid -lmgrid -lmpi -lm
+
+
+# What archiving to use
+AR = ar rv
+
+# What to use for indexing the archive
+#RANLIB = ranlib
+RANLIB = ar -ts
+
+#--------------------------------------------------------------------------
+# 
+# Do not change any of the following
+#
+VERNUM = 1.0
+
+#*************************************************************************
+# Compilation flags
+#*************************************************************************
+ddmalloc = no
+dmalloc = no
+debug = no

ThirdParty/mingwBuild/x64/patches/ParMGridGen-1.0/ParMGridGen/IMParMetis-2.0/ParMETISLib/macros.h

@@ -0,0 +1,137 @@
+/*
+ * Copyright 2001, Regents of the University of Minnesota
+ *
+ * macros.h
+ *
+ * This file contains macros used in multilevel
+ *
+ * George
+ */
+
+#include "rand48.h"
+
+/*************************************************************************
+* The following macro returns a random number in the specified range
+**************************************************************************/
+#define RandomInRange(u) ((int)(drand48()*((double)(u))))
+#define RandomInRangeFast(u) ((rand()>>2)%(u))
+
+#define amax(a, b) ((a) >= (b) ? (a) : (b))
+#define amin(a, b) ((a) >= (b) ? (b) : (a))
+
+#define AND(a, b) ((a) < 0 ? ((-(a))&(b)) : ((a)&(b)))
+#define OR(a, b) ((a) < 0 ? -((-(a))|(b)) : ((a)|(b)))
+#define XOR(a, b) ((a) < 0 ? -((-(a))^(b)) : ((a)^(b)))
+
+#define SWAP(a, b, tmp)  \
+                 do {(tmp) = (a); (a) = (b); (b) = (tmp);} while(0) 
+
+#define INC_DEC(a, b, val) \
+                 do {(a) += (val); (b) -= (val);} while(0)
+
+
+#define scopy(n, a, b) memcpy((b), (a), sizeof(float)*(n))
+#define idxcopy(n, a, b) memcpy((b), (a), sizeof(idxtype)*(n))
+#define realcopy(n, a, b) memcpy((b), (a), sizeof(realtype)*(n))
+
+
+#define HASHFCT(key, size) ((key)%(size))
+
+
+/*************************************************************************
+* Timer macros
+**************************************************************************/
+#define cleartimer(tmr) (tmr = 0.0)
+#define starttimer(tmr) (tmr -= MPI_Wtime())
+#define stoptimer(tmr) (tmr += MPI_Wtime())
+#define gettimer(tmr) (tmr)
+
+
+/*************************************************************************
+* This macro is used to handle dbglvl
+**************************************************************************/
+#define IFSET(a, flag, cmd) if ((a)&(flag)) (cmd);
+
+/*************************************************************************
+* These macros are used for debuging memory leaks
+**************************************************************************/
+#ifdef DMALLOC
+#define imalloc(n, msg) (malloc(sizeof(int)*(n)))
+#define fmalloc(n, msg) (malloc(sizeof(float)*(n)))
+#define idxmalloc(n, msg) (malloc(sizeof(idxtype)*(n)))
+#define realmalloc(n, msg) ((realtype *)malloc(sizeof(realtype)*(n)))
+#define ismalloc(n, val, msg) (iset((n), (val), malloc(sizeof(int)*(n))))
+#define idxsmalloc(n, val, msg) (idxset((n), (val), malloc(sizeof(idxtype)*(n))))
+#define realsmalloc(n, val, msg) (realset((n), (val), (realtype *)malloc(sizeof(realtype)*(n))))
+#define IMmalloc(a, b) (malloc(a))
+#endif
+
+#ifdef DMALLOC
+#   define MALLOC_CHECK(ptr)                                          \
+    if (malloc_verify((ptr)) == DMALLOC_VERIFY_ERROR) {  \
+        printf("***MALLOC_CHECK failed on line %d of file %s: " #ptr "\n", \
+              __LINE__, __FILE__);                               \
+        abort();                                                \
+    }
+#else
+#   define MALLOC_CHECK(ptr) ;
+#endif 
+
+/*************************************************************************
+* This macro converts a length array in a CSR one
+**************************************************************************/
+#define MAKECSR(i, n, a) \
+   do { \
+     for (i=1; i<n; i++) a[i] += a[i-1]; \
+     for (i=n; i>0; i--) a[i] = a[i-1]; \
+     a[0] = 0; \
+   } while(0) 
+
+
+
+
+#ifdef DEBUG
+#   define ASSERT(ctrl, expr)                                          \
+    if (!(expr)) {                                               \
+        myprintf(ctrl, "***ASSERTION failed on line %d of file %s: " #expr "\n", \
+              __LINE__, __FILE__);                               \
+        abort();                                                \
+    }
+#else
+#   define ASSERT(ctrl, expr) ;
+#endif 
+
+#ifdef DEBUG
+#   define ASSERTP(ctrl, expr,msg)                                          \
+    if (!(expr)) {                                               \
+        myprintf(ctrl, "***ASSERTION failed on line %d of file %s:" #expr "\n", \
+              __LINE__, __FILE__);                               \
+        myprintf msg ; \
+        abort();                                                \
+    }
+#else
+#   define ASSERTP(ctrl, expr,msg) ;
+#endif 
+
+#ifdef DEBUGS
+#   define ASSERTS(expr)                                          \
+    if (!(expr)) {                                               \
+        printf("***ASSERTION failed on line %d of file %s: " #expr "\n", \
+              __LINE__, __FILE__);                               \
+        abort();                                                \
+    }
+#else
+#   define ASSERTS(expr) ;
+#endif 
+
+#ifdef DEBUGS
+#   define ASSERTSP(expr, msg)                                          \
+    if (!(expr)) {                                               \
+        printf("***ASSERTION failed on line %d of file %s: " #expr "\n", \
+              __LINE__, __FILE__);                               \
+        printf msg ; \
+        abort();                                                \
+    }
+#else
+#   define ASSERTSP(expr, msg) ;
+#endif 

ThirdParty/mingwBuild/x64/patches/ParMGridGen-1.0/ParMGridGen/ParLib/macros.h

@@ -0,0 +1,108 @@
+/*
+ * Copyright 2001, Regents of the University of Minnesota
+ *
+ * macros.h
+ *
+ * This file contains macros used in multilevel
+ *
+ * George Irene
+ */
+
+#include "rand48.h"
+
+/*************************************************************************
+* This macro is used to normalize the weights of two nodes
+**************************************************************************/
+#define ARATIO1(dim, surf, vol) ((dim == 2) ? (pow((surf), 2)/(vol)) : (pow((surf), 1.5)/(vol))) 
+#define ARATIO(dim, surf, vol) ((dim == 2) ? ((surf)*(surf)/(vol)) : (sqrt((surf)*(surf)*(surf))/(vol)))
+#define ARATIO2(dim, surf, vol) ((dim == 2) ? ((surf)*(surf)*(surf)*(surf)/(vol)*(vol)) : ((surf)*(surf)*(surf)/((vol)*(vol))))
+
+
+/*************************************************************************
+* The following macro returns a random number in the specified range
+**************************************************************************/
+#define RandomInRange(u) ((int)(drand48()*((double)(u))))
+
+#define amax(a, b) ((a) >= (b) ? (a) : (b))
+#define amin(a, b) ((a) >= (b) ? (b) : (a))
+
+#define AND(a, b) ((a) < 0 ? ((-(a))&(b)) : ((a)&(b)))
+#define OR(a, b) ((a) < 0 ? -((-(a))|(b)) : ((a)|(b)))
+#define XOR(a, b) ((a) < 0 ? -((-(a))^(b)) : ((a)^(b)))
+
+#define SWAP(a, b, tmp)  \
+                 do {(tmp) = (a); (a) = (b); (b) = (tmp);} while(0) 
+
+#define INC_DEC(a, b, val) \
+                 do {(a) += (val); (b) -= (val);} while(0)
+
+
+#define HASHFCT(key, size) ((key)%(size))
+
+
+/*************************************************************************
+* Timer macros
+**************************************************************************/
+#undef cleartimer
+#undef starttimer
+#undef stoptimer
+#undef gettimer
+#define cleartimer(tmr) (tmr = 0.0)
+#define starttimer(tmr) (tmr -= MPI_Wtime())
+#define stoptimer(tmr) (tmr += MPI_Wtime())
+#define gettimer(tmr) (tmr)
+
+
+/*************************************************************************
+* This macro is used to handle dbglvl
+**************************************************************************/
+#define IFSET(a, flag, cmd) if ((a)&(flag)) (cmd);
+
+#undef ASSERT
+#undef ASSERTP
+
+#ifdef DEBUG
+#   define ASSERT(ctrl, expr)                                          \
+    if (!(expr)) {                                               \
+        MGridmyprintf(ctrl, "***ASSERTION failed on line %d of file %s: " #expr "\n", \
+              __LINE__, __FILE__);                               \
+        abort();                                                \
+    }
+#else
+#   define ASSERT(ctrl, expr) ;
+#endif 
+
+#ifdef DEBUG
+#   define ASSERTP(ctrl, expr,msg)                                          \
+    if (!(expr)) {                                               \
+        MGridmyprintf(ctrl, "***ASSERTION failed on line %d of file %s:" #expr "\n", \
+              __LINE__, __FILE__);                               \
+        MGridmyprintf msg ; \
+        abort();                                                \
+    }
+#else
+#   define ASSERTP(ctrl, expr,msg) ;
+#endif 
+
+#ifdef DEBUGS
+#   define ASSERTS(expr)                                          \
+    if (!(expr)) {                                               \
+        printf("***ASSERTION failed on line %d of file %s: " #expr "\n", \
+              __LINE__, __FILE__);                               \
+        abort();                                                \
+    }
+#else
+#   define ASSERTS(expr) ;
+#endif 
+
+#ifdef DEBUGS
+#   define ASSERTSP(expr, msg)                                          \
+    if (!(expr)) {                                               \
+        printf("***ASSERTION failed on line %d of file %s: " #expr "\n", \
+              __LINE__, __FILE__);                               \
+        printf msg ; \
+        abort();                                                \
+    }
+#else
+#   define ASSERTSP(expr, msg) ;
+#endif 

ThirdParty/mingwBuild/x64/patches/metis-5.1.0/GKlib/gk_arch.h

@@ -0,0 +1,71 @@
+/*!
+\file gk_arch.h
+\brief This file contains various architecture-specific declerations
+
+\date   Started 3/27/2007
+\author George
+\version\verbatim $Id: gk_arch.h 10711 2011-08-31 22:23:04Z karypis $ \endverbatim
+*/
+
+#ifndef _GK_ARCH_H_
+#define _GK_ARCH_H_
+
+/*************************************************************************
+* Architecture-specific differences in header files
+**************************************************************************/
+#ifdef LINUX
+#if !defined(__USE_XOPEN)
+#define __USE_XOPEN
+#endif
+#if !defined(_XOPEN_SOURCE)
+#define _XOPEN_SOURCE 600
+#endif
+#if !defined(__USE_XOPEN2K)
+#define __USE_XOPEN2K
+#endif
+#endif
+
+
+#ifdef HAVE_EXECINFO_H
+#include <execinfo.h>
+#endif
+
+
+#ifdef __MSC__ 
+  #include "ms_stdint.h"
+  #include "ms_inttypes.h"
+  #include "ms_stat.h"
+#else
+#ifndef SUNOS
+  #include <stdint.h>
+#endif
+  #include <inttypes.h>
+  #include <sys/types.h>
+//  #include <sys/resource.h>
+  #include <sys/time.h>
+#endif
+
+
+/*************************************************************************
+* Architecture-specific modifications
+**************************************************************************/
+#ifdef WIN32
+typedef ptrdiff_t ssize_t;
+#endif
+
+
+#ifdef SUNOS
+#define PTRDIFF_MAX  INT64_MAX
+#endif
+
+#ifdef __MSC__
+/* MSC does not have rint() function */
+#define rint(x) ((int)((x)+0.5))  
+
+/* MSC does not have INFINITY defined */
+#ifndef INFINITY
+#define INFINITY FLT_MAX
+#endif
+#endif
+
+#endif

ThirdParty/mingwBuild/x64/patches/metis-5.1.0/GKlib/gk_getopt.h

@@ -0,0 +1,64 @@
+/*!
+\file gk_getopt.h
+\brief This file contains GNU's externs/structs/prototypes
+
+\date   Started 3/27/2007
+\author George
+\version\verbatim $Id: gk_getopt.h 10711 2011-08-31 22:23:04Z karypis $ \endverbatim
+*/
+
+#ifndef _GK_GETOPT_H_
+#define _GK_GETOPT_H_
+
+
+/* Externals from getopt.c */
+//extern char *gk_optarg;
+//extern int gk_optind;
+//extern int gk_opterr;
+//extern int gk_optopt;
+
+
+/*! \brief The structure that stores the information about the command-line options 
+
+This structure describes a single long option name for the sake of 
+gk_getopt_long(). The argument <tt>long_options</tt> must be an array 
+of these structures, one for each long option. Terminate the array with 
+an element containing all zeros.
+*/
+struct gk_option {
+  char *name;       /*!< This field is the name of the option. */
+  int has_arg;      /*!< This field says whether the option takes an argument. 
+                         It is an integer, and there are three legitimate values: 
+                         no_argument, required_argument and optional_argument. 
+                         */
+  int *flag;        /*!< See the discussion on ::gk_option#val */
+  int val;          /*!< These fields control how to report or act on the option 
+                         when it occurs. 
+                         
+                         If flag is a null pointer, then the val is a value which 
+                         identifies this option. Often these values are chosen 
+                         to uniquely identify particular long options.
+
+                         If flag is not a null pointer, it should be the address 
+                         of an int variable which is the flag for this option. 
+                         The value in val is the value to store in the flag to 
+                         indicate that the option was seen. */
+};
+
+/* Names for the values of the `has_arg' field of `struct gk_option'.  */
+#define no_argument		0
+#define required_argument	1
+#define optional_argument	2
+
+
+/* Function prototypes */
+//extern int gk_getopt(int __argc, char **__argv, char *__shortopts);
+//extern int gk_getopt_long(int __argc, char **__argv, char *__shortopts,
+//              struct gk_option *__longopts, int *__longind);
+//extern int gk_getopt_long_only (int __argc, char **__argv,
+//              char *__shortopts, struct gk_option *__longopts, int *__longind);
+
+
+
+#endif
+

ThirdParty/mingwBuild/x64/patches/parmetis-4.0.3/metis/GKlib/gk_arch.h

@@ -0,0 +1,71 @@
+/*!
+\file gk_arch.h
+\brief This file contains various architecture-specific declerations
+
+\date   Started 3/27/2007
+\author George
+\version\verbatim $Id: gk_arch.h 10711 2011-08-31 22:23:04Z karypis $ \endverbatim
+*/
+
+#ifndef _GK_ARCH_H_
+#define _GK_ARCH_H_
+
+/*************************************************************************
+* Architecture-specific differences in header files
+**************************************************************************/
+#ifdef LINUX
+#if !defined(__USE_XOPEN)
+#define __USE_XOPEN
+#endif
+#if !defined(_XOPEN_SOURCE)
+#define _XOPEN_SOURCE 600
+#endif
+#if !defined(__USE_XOPEN2K)
+#define __USE_XOPEN2K
+#endif
+#endif
+
+
+#ifdef HAVE_EXECINFO_H
+#include <execinfo.h>
+#endif
+
+
+#ifdef __MSC__ 
+  #include "ms_stdint.h"
+  #include "ms_inttypes.h"
+  #include "ms_stat.h"
+#else
+#ifndef SUNOS
+  #include <stdint.h>
+#endif
+  #include <inttypes.h>
+  #include <sys/types.h>
+//  #include <sys/resource.h>
+  #include <sys/time.h>
+#endif
+
+
+/*************************************************************************
+* Architecture-specific modifications
+**************************************************************************/
+#ifdef WIN32
+typedef ptrdiff_t ssize_t;
+#endif
+
+
+#ifdef SUNOS
+#define PTRDIFF_MAX  INT64_MAX
+#endif
+
+#ifdef __MSC__
+/* MSC does not have rint() function */
+#define rint(x) ((int)((x)+0.5))  
+
+/* MSC does not have INFINITY defined */
+#ifndef INFINITY
+#define INFINITY FLT_MAX
+#endif
+#endif
+
+#endif

ThirdParty/mingwBuild/x64/patches/parmetis-4.0.3/metis/GKlib/gk_getopt.h

@@ -0,0 +1,64 @@
+/*!
+\file gk_getopt.h
+\brief This file contains GNU's externs/structs/prototypes
+
+\date   Started 3/27/2007
+\author George
+\version\verbatim $Id: gk_getopt.h 10711 2011-08-31 22:23:04Z karypis $ \endverbatim
+*/
+
+#ifndef _GK_GETOPT_H_
+#define _GK_GETOPT_H_
+
+
+/* Externals from getopt.c */
+//extern char *gk_optarg;
+//extern int gk_optind;
+//extern int gk_opterr;
+//extern int gk_optopt;
+
+
+/*! \brief The structure that stores the information about the command-line options 
+
+This structure describes a single long option name for the sake of 
+gk_getopt_long(). The argument <tt>long_options</tt> must be an array 
+of these structures, one for each long option. Terminate the array with 
+an element containing all zeros.
+*/
+struct gk_option {
+  char *name;       /*!< This field is the name of the option. */
+  int has_arg;      /*!< This field says whether the option takes an argument. 
+                         It is an integer, and there are three legitimate values: 
+                         no_argument, required_argument and optional_argument. 
+                         */
+  int *flag;        /*!< See the discussion on ::gk_option#val */
+  int val;          /*!< These fields control how to report or act on the option 
+                         when it occurs. 
+                         
+                         If flag is a null pointer, then the val is a value which 
+                         identifies this option. Often these values are chosen 
+                         to uniquely identify particular long options.
+
+                         If flag is not a null pointer, it should be the address 
+                         of an int variable which is the flag for this option. 
+                         The value in val is the value to store in the flag to 
+                         indicate that the option was seen. */
+};
+
+/* Names for the values of the `has_arg' field of `struct gk_option'.  */
+#define no_argument		0
+#define required_argument	1
+#define optional_argument	2
+
+
+/* Function prototypes */
+//extern int gk_getopt(int __argc, char **__argv, char *__shortopts);
+//extern int gk_getopt_long(int __argc, char **__argv, char *__shortopts,
+//              struct gk_option *__longopts, int *__longind);
+//extern int gk_getopt_long_only (int __argc, char **__argv,
+//              char *__shortopts, struct gk_option *__longopts, int *__longind);
+
+
+
+#endif
+

ThirdParty/mingwBuild/x64/patches/pthreads-w32-2-9-1-release/Pre-built.2/include/sched.h

@@ -0,0 +1,183 @@
+/*
+ * Module: sched.h
+ *
+ * Purpose:
+ *      Provides an implementation of POSIX realtime extensions
+ *      as defined in 
+ *
+ *              POSIX 1003.1b-1993      (POSIX.1b)
+ *
+ * --------------------------------------------------------------------------
+ *
+ *      Pthreads-win32 - POSIX Threads Library for Win32
+ *      Copyright(C) 1998 John E. Bossom
+ *      Copyright(C) 1999,2005 Pthreads-win32 contributors
+ * 
+ *      Contact Email: rpj@callisto.canberra.edu.au
+ * 
+ *      The current list of contributors is contained
+ *      in the file CONTRIBUTORS included with the source
+ *      code distribution. The list can also be seen at the
+ *      following World Wide Web location:
+ *      http://sources.redhat.com/pthreads-win32/contributors.html
+ * 
+ *      This library is free software; you can redistribute it and/or
+ *      modify it under the terms of the GNU Lesser General Public
+ *      License as published by the Free Software Foundation; either
+ *      version 2 of the License, or (at your option) any later version.
+ * 
+ *      This library is distributed in the hope that it will be useful,
+ *      but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *      MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ *      Lesser General Public License for more details.
+ * 
+ *      You should have received a copy of the GNU Lesser General Public
+ *      License along with this library in the file COPYING.LIB;
+ *      if not, write to the Free Software Foundation, Inc.,
+ *      59 Temple Place - Suite 330, Boston, MA 02111-1307, USA
+ */
+#if !defined(_SCHED_H)
+#define _SCHED_H
+
+#undef PTW32_SCHED_LEVEL
+
+#if defined(_POSIX_SOURCE)
+#define PTW32_SCHED_LEVEL 0
+/* Early POSIX */
+#endif
+
+#if defined(_POSIX_C_SOURCE) && _POSIX_C_SOURCE >= 199309
+#undef PTW32_SCHED_LEVEL
+#define PTW32_SCHED_LEVEL 1
+/* Include 1b, 1c and 1d */
+#endif
+
+#if defined(INCLUDE_NP)
+#undef PTW32_SCHED_LEVEL
+#define PTW32_SCHED_LEVEL 2
+/* Include Non-Portable extensions */
+#endif
+
+#define PTW32_SCHED_LEVEL_MAX 3
+
+#if ( defined(_POSIX_C_SOURCE) && _POSIX_C_SOURCE >= 200112 )  || !defined(PTW32_SCHED_LEVEL)
+#define PTW32_SCHED_LEVEL PTW32_SCHED_LEVEL_MAX
+/* Include everything */
+#endif
+
+
+#if defined(__GNUC__) && !defined(__declspec)
+# error Please upgrade your GNU compiler to one that supports __declspec.
+#endif
+
+/*
+ * When building the library, you should define PTW32_BUILD so that
+ * the variables/functions are exported correctly. When using the library,
+ * do NOT define PTW32_BUILD, and then the variables/functions will
+ * be imported correctly.
+ */
+#if !defined(PTW32_STATIC_LIB)
+#  if defined(PTW32_BUILD)
+#    define PTW32_DLLPORT __declspec (dllexport)
+#  else
+#    define PTW32_DLLPORT __declspec (dllimport)
+#  endif
+#else
+#  define PTW32_DLLPORT
+#endif
+
+/*
+ * This is a duplicate of what is in the autoconf config.h,
+ * which is only used when building the pthread-win32 libraries.
+ */
+
+#if !defined(PTW32_CONFIG_H)
+#  if defined(WINCE)
+#    define NEED_ERRNO
+#    define NEED_SEM
+#  endif
+#  if defined(__MINGW64__)
+#    define HAVE_STRUCT_TIMESPEC
+#    define HAVE_MODE_T
+#  elif defined(_UWIN) || defined(__MINGW32__)
+#    define HAVE_MODE_T
+#  endif
+#endif
+
+/*
+ *
+ */
+
+#if PTW32_SCHED_LEVEL >= PTW32_SCHED_LEVEL_MAX
+#if defined(NEED_ERRNO)
+#include "need_errno.h"
+#else
+#include <errno.h>
+#endif
+#endif /* PTW32_SCHED_LEVEL >= PTW32_SCHED_LEVEL_MAX */
+
+#if (defined(__MINGW64__) || defined(__MINGW32__)) || defined(_UWIN)
+# if PTW32_SCHED_LEVEL >= PTW32_SCHED_LEVEL_MAX
+/* For pid_t */
+#  include <sys/types.h>
+/* Required by Unix 98 */
+#  include <time.h>
+# else
+   typedef __int64 pid_t;
+# endif
+#else
+ typedef int pid_t;
+#endif
+
+/* Thread scheduling policies */
+
+enum {
+  SCHED_OTHER = 0,
+  SCHED_FIFO,
+  SCHED_RR,
+  SCHED_MIN   = SCHED_OTHER,
+  SCHED_MAX   = SCHED_RR
+};
+
+struct sched_param {
+  int sched_priority;
+};
+
+#if defined(__cplusplus)
+extern "C"
+{
+#endif                          /* __cplusplus */
+
+PTW32_DLLPORT int __cdecl sched_yield (void);
+
+PTW32_DLLPORT int __cdecl sched_get_priority_min (int policy);
+
+PTW32_DLLPORT int __cdecl sched_get_priority_max (int policy);
+
+PTW32_DLLPORT int __cdecl sched_setscheduler (pid_t pid, int policy);
+
+PTW32_DLLPORT int __cdecl sched_getscheduler (pid_t pid);
+
+/*
+ * Note that this macro returns ENOTSUP rather than
+ * ENOSYS as might be expected. However, returning ENOSYS
+ * should mean that sched_get_priority_{min,max} are
+ * not implemented as well as sched_rr_get_interval.
+ * This is not the case, since we just don't support
+ * round-robin scheduling. Therefore I have chosen to
+ * return the same value as sched_setscheduler when
+ * SCHED_RR is passed to it.
+ */
+#define sched_rr_get_interval(_pid, _interval) \
+  ( errno = ENOTSUP, (int) -1 )
+
+
+#if defined(__cplusplus)
+}                               /* End of extern "C" */
+#endif                          /* __cplusplus */
+
+#undef PTW32_SCHED_LEVEL
+#undef PTW32_SCHED_LEVEL_MAX
+
+#endif                          /* !_SCHED_H */
+

ThirdParty/mingwBuild/x64/patches/scotch_6.0.0/src/Makefile.inc

@@ -0,0 +1,70 @@
+# This make include file is intended for building under MinGW32. As is,
+# it relies on :
+#   - pthread-win32 (http://sourceware.org/pthreads-win32/),
+#   - zlib (http://www.zlib.net/)
+#   - mpich2 (http://www.mcs.anl.gov/research/projects/mpich2/).
+# It must be adapted to reflect your environment, in particular
+# installation root directories, include path and library name.
+# Since all files are linked with the MPI libraries, this file is
+# for compiling PT-Scotch only. To compile Scotch, remove the
+# -DSCOTCH_PTSCOTCH flag, as well as all references to MPI in the
+# CFLAGS and CLIBFLAGS	=
+#LDFLAGS variables.
+
+#MPI_ROOTDIR		= /c/Programs/OpenMPI_v1.6.1-x64
+
+EXE			=
+LIB			= .a
+OBJ			= .o
+
+MAKE			= make
+AR			= ar
+ARFLAGS			= -ruv
+CAT			= cat
+CCS			= gcc
+CCP			= mpicc
+CCD			= mpicc -I$(MPI_ROOTDIR)/include 
+
+#--- Compiler/loader flags
+CFLAGS_CPL		= -O0 -g3 --std=c99
+CFLAGS_INC		= 
+CFLAGS_DEF		= -DCOMMON_RANDOM_FIXED_SEED -DCOMMON_STUB_FORK -DSCOTCH_PTSCOTCH -DSCOTCH_RENAME -D'pipe(pfds)=_pipe(pfds,1024,0x8000)' -DHAVE_STDINT_H=0 -DHAVE_UINT_T=1
+CLIBFLAGS	=
+LDFLAGS   		= 
+
+PGMFILES=$(PROGRAMFILES)
+
+#--- MPI
+CFLAGS_INC	+= -I$(MPI_ROOTDIR)/include
+#--- Comment/Uncomment for threaded MPI
+CLIBFLAGS	=
+LDFLAGS    	+= -L$(MPI_ROOTDIR)/bin -lm -lmpi -lmpid
+#CLIBFLAGS	=
+#LDFLAGS    	+= -L$(MPI_ROOTDIR)/lib -lm -lmpich2mt
+
+#--- Pthread : Uncomment for pthread support
+#PTHREAD_ROOTDIR		= $(PGMFILES)/pthread-win32
+#CFLAGS_INC		+= -I$(PTHREAD_ROOTDIR)/include
+#CLIBFLAGS	=
+LDFLAGS		+= -L$(PTHREADS_HOME)/Pre-built.2/lib/x64 -lpthreadGC2
+
+#--- zlib: Uncomment for compressed files
+#ZLIB_ROOTDIR		= $(PGMFILES)/zlib-1.2.3
+#CFLAGS_INC	+= -I$(ZLIB_ROOTDIR)/include
+#CLIBFLAGS	=
+LDFLAGS	+= -lz
+
+#--- COMMON_PTHREAD: Uncomment for compressed files
+#CFLAGS_DEF	+= -DCOMMON_PTHREAD -DCOMMON_FILE_COMPRESS_GZ
+
+#--- SCOTCH_PTHREAD: Uncomment for threaded MPI
+#CFLAGS_DEF	+= -DSCOTCH_PTHREAD
+
+CFLAGS		= $(CFLAGS_CPL) $(CFLAGS_INC) $(CFLAGS_DEF)
+CP			= cp
+LEX			= flex -Pscotchyy -olex.yy.c
+LN			= cp
+MKDIR			= mkdir
+MV			= mv
+RANLIB			= ranlib
+YACC			= bison -pscotchyy -y -b y

ThirdParty/mingwBuild/x64/patches/system/include/rand48.h

@@ -0,0 +1,19 @@
+#ifndef RAND48_H
+#define RAND48_H
+
+#define drand48()       (rand()*(1./RAND_MAX))
+static long _rand = 1;
+
+static __inline__ void srand48(long seed)
+{
+        _rand = seed;
+}
+
+static __inline__ long lrand48(void)
+{
+        long val = (int)(abs(10000.0*sin(_rand)));
+        _rand++;
+        return val;     
+}
+
+#endif //RAND48_H

ThirdParty/mingwBuild/x64/patches/system/include/sys/times.h

@@ -0,0 +1,40 @@
+// From http://www.linuxjournal.com/article/5574
+
+#ifndef _TIMES_H
+#define _TIMES_H
+
+#ifdef _WIN32
+#include <sys/timeb.h>
+#include <sys/types.h>
+#include <winsock2.h>
+
+int gettimeofday(struct timeval* t,void* timezone);
+
+// from linux's sys/times.h
+
+//#include <features.h>
+
+#define __need_clock_t
+#include <time.h>
+
+
+/* Structure describing CPU time used by a process and its children.  */
+struct tms
+  {
+    clock_t tms_utime;          /* User CPU time.  */
+    clock_t tms_stime;          /* System CPU time.  */
+
+    clock_t tms_cutime;         /* User CPU time of dead children.  */
+    clock_t tms_cstime;         /* System CPU time of dead children.  */
+  };
+
+/* Store the CPU time used by this process and all its
+   dead children (and their dead children) in BUFFER.
+   Return the elapsed real time, or (clock_t) -1 for errors.
+   All times are in CLK_TCKths of a second.  */
+clock_t times (struct tms *__buffer);
+
+typedef long long suseconds_t ;
+
+#endif
+#endif

applications/solvers/compressible/rhoCentralFoam/BCs/Make/options

@@ -3,7 +3,7 @@ EXE_INC = \
     -I$(LIB_SRC)/thermophysicalModels/basic/lnInclude \
     -I$(LIB_SRC)/thermophysicalModels/specie/lnInclude
 
-EXE_LIBS = \
+LIB_LIBS = \
     -lfiniteVolume \
     -lbasicThermophysicalModels \
     -lspecie

applications/solvers/compressible/rhoCentralFoam/Make/options

@@ -4,6 +4,7 @@ EXE_INC = \
     -I$(LIB_SRC)/thermophysicalModels/specie/lnInclude \
     -IBCs/lnInclude \
     -I$(LIB_SRC)/sampling/lnInclude
+
 EXE_LIBS = \
     -lfiniteVolume \
     -lbasicThermophysicalModels \

applications/solvers/multiphase/twoPhaseEulerFoam/interfacialModels/Make/options

@@ -3,4 +3,5 @@ EXE_INC = \
     -I../phaseModel/lnInclude
 
 LIB_LIBS = \
+    -lfiniteVolume \
     -lphaseModel

applications/solvers/multiphase/twoPhaseEulerFoam/kineticTheoryModels/Make/options

@@ -3,3 +3,7 @@ EXE_INC = \
     -I$(LIB_SRC)/finiteVolume/lnInclude \
     -I../phaseModel/lnInclude \
     -I../interfacialModels/lnInclude
+
+LIB_LIBS = \
+    -lfiniteVolume \
+    -lphaseModel

applications/solvers/multiphase/twoPhaseEulerFoam/phaseModel/Make/options

@@ -3,4 +3,5 @@ EXE_INC = \
     -I$(LIB_SRC)/transportModels/incompressible/lnInclude
 
 LIB_LIBS = \
+    -lfiniteVolume \
     -lincompressibleTransportModels

applications/solvers/solidMechanics/deprecatedSolvers/materialModels/Make/options

@@ -1,5 +1,5 @@
 EXE_INC = \
     -I$(LIB_SRC)/finiteVolume/lnInclude
 
-EXE_LIBS = \
+LIB_LIBS = \
     -lfiniteVolume

applications/solvers/surfaceTracking/freeSurface/Make/options

@@ -7,7 +7,7 @@ EXE_INC = \
     -I$(LIB_SRC)/tetFiniteElement/lnInclude \
     -I$(LIB_SRC)/dynamicMesh/meshMotion/tetMotionSolver/lnInclude
 
-EXE_LIBS = \
+LIB_LIBS = \
     -lfiniteArea \
     -lfiniteVolume \
     -lmeshTools \

applications/utilities/thermophysical/chemkinToFoam/Make/options

@@ -1,6 +1,13 @@
+ifneq ($(FLEX_DIR), "")
+EXE_INC = \
+    -I$(FLEX_DIR)/include \
+    -I$(LIB_SRC)/thermophysicalModels/specie/lnInclude \
+    -I$(LIB_SRC)/thermophysicalModels/reactionThermo/lnInclude
+else
 EXE_INC = \
     -I$(LIB_SRC)/thermophysicalModels/specie/lnInclude \
     -I$(LIB_SRC)/thermophysicalModels/reactionThermo/lnInclude
+endif
 
 EXE_LIBS = \
     -lreactionThermophysicalModels \

etc/bashrc

@@ -56,6 +56,12 @@ foamInstall=$HOME/$WM_PROJECT
 # END OF (NORMAL) USER EDITABLE PART
 ################################################################################
 
+# Set $USER if it has not been set (eg. on Windows/MSYS systems)
+if [ -z $USER ]
+then
+    export USER=`whoami`
+fi
+
 # note the location for later use (eg, in job scripts)
 : ${FOAM_INST_DIR:=$foamInstall}; export FOAM_INST_DIR
 
@@ -192,6 +198,15 @@ export FOAM_SIGFPE=
 export WM_ARCH=`uname -s`
 
 case $WM_ARCH in
+MINGW32_NT-6.1)
+    WM_ARCH=MINGW32_NT-6.1
+    export WM_ARCH_BASE=mingw
+    export WM_COMPILER_LIB_ARCH=64
+    export WM_CFLAGS='-m64 -fPIC'
+    export WM_CXXFLAGS='-m64 -fPIC'
+    export WM_LDFLAGS='-m64'
+    ;;
+
 Linux)
     WM_ARCH=linux
 

etc/bashrc.mingw

@@ -0,0 +1,127 @@
+#!/bin/sh
+#----------------------------------*-sh-*--------------------------------------
+# =========                 |
+# \\      /  F ield         | foam-extend: Open Source CFD
+#  \\    /   O peration     | Version:     3.2
+#   \\  /    A nd           | Web:         http://www.foam-extend.org
+#    \\/     M anipulation  | For copyright notice see file Copyright
+#------------------------------------------------------------------------------
+# License
+#     This file is part of foam-extend.
+#
+#     foam-extend is free software: you can redistribute it and/or modify it
+#     under the terms of the GNU General Public License as published by the
+#     Free Software Foundation, either version 3 of the License, or (at your
+#     option) any later version.
+#
+#     foam-extend is distributed in the hope that it will be useful, but
+#     WITHOUT ANY WARRANTY; without even the implied warranty of
+#     MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+#     General Public License for more details.
+#
+#     You should have received a copy of the GNU General Public License
+#     along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+#
+# Script
+#     etc/bashrc.mingw
+#
+# Description
+#     Startup file for FOAM for use with MSYS shell for MinGW-based builds on Windows.
+#     Calls the main etc/bashrc script.
+#     Sourced from ~/.profile or ~/.bashrc
+#
+# Author:
+#     Cesare Guardino, Alstom Power Ltd., (2015)
+#
+#------------------------------------------------------------------------------
+
+# {{{ DEFINE USER EDITABLE FUNCTIONS
+set_system_paths() {
+    echo "Setting installations directories of required tools ..." 
+    export CMAKE_HOME=/c/Programs/cmake-3.2.3-win32-x86
+    #export GIT_HOME=/c/Programs/Git
+    #export JAVA_HOME="/c/Program Files/Java/jre1.8.0_45"
+    export MINGW_HOME=/c/Programs/x86_64-4.8.2-release-win32-seh-rt_v3-rev3/mingw64
+    export MPI_ROOTDIR=/c/Programs/OpenMPI_v1.6.1-x64
+    export PERL_HOME=/c/Programs/strawberry-perl-5.20.2.1-64bit/perl
+    #export PEXPORTS_HOME=/c/Programs/pexports-0.46-mingw32
+    #export PYTHON_HOME=/c/Programs/Python27
+    #export SUBVERSION_HOME=/c/Programs/svn-win32-1.8.13
+    export WGET_HOME=/c/Programs/wget-1.11.4-1
+    export ZIP_HOME="/c/Program Files/7-Zip"
+}
+
+add_to_path() {
+    echo "Adding required tools to PATH ..." 
+    export PATH=$ZIP_HOME:$PATH
+    export PATH=$WGET_HOME/bin:$PATH
+    #export PATH=$JAVA_HOME/bin:$PATH
+    #export PATH=$PYTHON_HOME:$PATH
+    #export PATH=$SUBVERSION_HOME/bin:$PATH
+    #export PATH=$GIT_HOME/cmd:$PATH
+    export PATH=$PERL_HOME/bin:$PATH
+    export PATH=$CMAKE_HOME/bin:$PATH
+    export PATH=$MPI_ROOTDIR/bin:$PATH
+    #export PATH=$PEXPORTS_HOME/bin:$PATH
+    export PATH=$MINGW_HOME/bin:$PATH
+}
+# }}}
+
+# {{{ DEFINE PROCESS FUNCTIONS
+setup_foam_env() {
+    : ${WM_OSTYPE:=POSIX}; export WM_OSTYPE
+    export export FLEX_DIR=$(echo $WD\.. | sed 's/\\/\//g' | sed 's/\(.*\):/\/\1/')
+    FOAM_ETC_DIR=$( cd "$( dirname "${BASH_SOURCE[0]}" )" && pwd )
+    export FOAM_INST_DIR=$(readlink -f $FOAM_ETC_DIR/../..)
+    . $FOAM_ETC_DIR/bashrc
+    . $FOAM_ETC_DIR/prefs.sh.mingw
+}
+
+set_OMPI_env() {
+    echo "Setting OpenMPI environment settings ..." 
+    export OMPI_MPICC=gcc.exe
+    export OMPI_MPIXX=g++.exe
+    export OMPI_CXXFLAGS==-I$MPI_ROOTDIR/include
+    export OMPI_CFLAGS=-I$MPI_ROOTDIR/include
+    export OMPI_CXXFLAGS=-I$MPI_ROOTDIR/include
+    export OMPI_LDFLAGS=-L$MPI_ROOTDIR/lib
+    export OMPI_LIBS=$OMPI_LDFLAGS
+}
+
+check_versions() {
+    echo "Checking versions of installed system tools (based on PATH) ..."
+    echo "7-Zip:      " `which 7z`    [`(7z --help 2>&1) 2> /dev/null | head -2`]
+    echo "CMake:      " `which cmake`    [`(cmake --version 2>&1) 2> /dev/null | head -1`]
+    echo "G++:        " `which g++`    [`(g++ --version 2>&1) 2> /dev/null | head -1`]
+    echo "GCC:        " `which gcc`    [`(gcc --version 2>&1) 2> /dev/null | head -1`]
+    echo "Git:        " `which git`    [`(git --version 2>&1) 2> /dev/null | head -1`]
+    echo "Java:       " `which java`    [`(java -version 2>&1) 2> /dev/null | head -1`]
+    echo "Make:       " `which make`    [`(make --version 2>&1) 2> /dev/null | head -1`]
+    echo "MinGW-w64:  " $MINGW_HOME
+    echo "OpenMPI:    " `which mpirun`    [`(mpirun --version 2>&1) 2> /dev/null | head -1`]
+    echo "PEexports:  " `which pexports`    [`(pexports -v 2>&1) 2> /dev/null | head -1`]
+    echo "Perl:       " `which perl`    [`(perl -v 2>&1) 2> /dev/null | head -2`]
+    echo "Python:     " `which python`    [`(python --version 2>&1) 2> /dev/null | head -1`]
+    echo "Subversion: " `which svn`    [`(svn --version 2>&1) 2> /dev/null | head -1`]
+    echo "Wget:       " `which wget`    [`(wget --version 2>&1) 2> /dev/null | head -3`]
+}
+
+finish() {
+    echo
+    echo "=========================================================================================="
+    echo "FOAM_INST_DIR=$FOAM_INST_DIR"
+    echo "ENVIRONMENT SETUP COMPLETE."
+    echo "=========================================================================================="
+    echo
+}
+# }}}
+
+# {{{ MAIN EXECUTION
+set_system_paths
+setup_foam_env
+add_to_path
+set_OMPI_env
+check_versions
+finish
+# }}}
+

etc/prefs.sh.mingw

@@ -0,0 +1,242 @@
+#----------------------------------*-sh-*--------------------------------------
+# =========                 |
+# \\      /  F ield         | foam-extend: Open Source CFD
+#  \\    /   O peration     | Version:     3.2
+#   \\  /    A nd           | Web:         http://www.foam-extend.org
+#    \\/     M anipulation  | For copyright notice see file Copyright
+#------------------------------------------------------------------------------
+# License
+#     This file is part of foam-extend.
+#
+#     foam-extend is free software: you can redistribute it and/or modify it
+#     under the terms of the GNU General Public License as published by the
+#     Free Software Foundation, either version 3 of the License, or (at your
+#     option) any later version.
+#
+#     foam-extend is distributed in the hope that it will be useful, but
+#     WITHOUT ANY WARRANTY; without even the implied warranty of
+#     MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+#     General Public License for more details.
+#
+#     You should have received a copy of the GNU General Public License
+#     along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+#
+# File
+#     etc/prefs.sh
+#
+# Description
+#     Preset variables for the FOAM configuration - POSIX shell syntax.
+#
+#     The prefs.sh file will be sourced by the FOAM etc/bashrc when it is
+#     found
+#
+#------------------------------------------------------------------------------
+
+export FOAM_VERBOSE=1
+
+# Specify system compiler
+# ~~~~~~~~~~~~~~~~~~~~~~~
+#compilerInstall=System
+#compilerInstall=FOAM
+
+# Specify system openmpi
+# ~~~~~~~~~~~~~~~~~~~~~~
+#
+# Normally, you don't need to set more than these 3 env. variables
+# The other openmpi related variables will be initialized using
+# the command mpicc --showme:
+#
+#export WM_MPLIB=SYSTEMOPENMPI
+export OPENMPI_DIR=$MPI_ROOTDIR
+export OPENMPI_BIN_DIR=$OPENMPI_DIR/bin
+#
+#export OPENMPI_LIB_DIR="`$OPENMPI_BIN_DIR/mpicc --showme:libdirs`"
+#export OPENMPI_INCLUDE_DIR="`$OPENMPI_BIN_DIR/mpicc --showme:incdirs`"
+#export OPENMPI_COMPILE_FLAGS="`$OPENMPI_BIN_DIR/mpicc --showme:compile`"
+#export OPENMPI_LINK_FLAGS="`$OPENMPI_BIN_DIR/mpicc --showme:link`"
+
+# Specify system installed ThirdParty packages/libraries
+# NB: The packages installed under $WM_THIRD_PARTY_DIR
+#     will always override these values.
+#     So build your ThirdParty directory accordingly.
+# ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+# System installed CUDA
+#export CUDA_SYSTEM=1
+#export CUDA_DIR=path_to_system_installed_cuda
+#export CUDA_BIN_DIR=$CUDA_DIR/bin
+#export CUDA_LIB_DIR=$CUDA_DIR/lib
+#export CUDA_INCLUDE_DIR=$CUDA_DIR/include
+#export CUDA_ARCH=sm_20
+
+# System installed Mesquite
+#export MESQUITE_SYSTEM=1
+export MESQUITE_DIR=$WM_THIRD_PARTY_DIR/packages/mesquite-2.1.2
+export MESQUITE_BIN_DIR=$MESQUITE_DIR/bin
+export MESQUITE_LIB_DIR=$MESQUITE_DIR/lib
+export MESQUITE_INCLUDE_DIR=$MESQUITE_DIR/include
+
+# System installed Metis
+#export METIS_SYSTEM=1
+export METIS_DIR=$WM_THIRD_PARTY_DIR/packages/metis-5.1.0
+export METIS_BIN_DIR=$METIS_DIR/bin
+export METIS_LIB_DIR=$METIS_DIR/lib
+export METIS_INCLUDE_DIR=$METIS_DIR/include
+
+# System installed ParMetis
+#export PARMETIS_SYSTEM=1
+export PARMETIS_DIR=$WM_THIRD_PARTY_DIR/packages/parmetis-4.0.3
+export PARMETIS_BIN_DIR=$PARMETIS_DIR/bin
+export PARMETIS_LIB_DIR=$PARMETIS_DIR/lib
+export PARMETIS_INCLUDE_DIR=$PARMETIS_DIR/include
+
+# System installed ParMGridgen
+#export PARMGRIDGEN_SYSTEM=1
+export PARMGRIDGEN_DIR=$WM_THIRD_PARTY_DIR/packages/ParMGridGen-1.0
+export PARMGRIDGEN_BIN_DIR=$PARMGRIDGEN_DIR/bin
+export PARMGRIDGEN_LIB_DIR=$PARMGRIDGEN_DIR/lib
+export PARMGRIDGEN_INCLUDE_DIR=$PARMGRIDGEN_DIR/include
+
+# System installed Libccmio
+#export LIBCCMIO_SYSTEM=1
+#export LIBCCMIO_DIR=path_to_system_installed_libccmio
+#export LIBCCMIO_BIN_DIR=$LIBCCMIO_DIR/bin
+#export LIBCCMIO_LIB_DIR=$LIBCCMIO_DIR/lib
+#export LIBCCMIO_INCLUDE_DIR=$LIBCCMIO_DIR/include
+
+# System installed Scotch
+#export SCOTCH_SYSTEM=1
+export SCOTCH_DIR=$WM_THIRD_PARTY_DIR/packages/scotch_6.0.0
+export SCOTCH_BIN_DIR=$SCOTCH_DIR/bin
+export SCOTCH_LIB_DIR=$SCOTCH_DIR/lib
+export SCOTCH_INCLUDE_DIR=$SCOTCH_DIR/include
+
+# System installed CMake
+#export CMAKE_SYSTEM=1
+#export CMAKE_DIR=path_to_system_installed_cmake
+#export CMAKE_BIN_DIR=$CMAKE_DIR/bin
+
+# System installed Python
+#export PYTHON_SYSTEM=1
+#export PYTHON_DIR=path_to_system_installed_python
+#export PYTHON_BIN_DIR=$PYTHON_DIR/bin
+
+# System installed PyFoam
+#export PYFOAM_SYSTEM=1
+#export PYFOAM_DIR=path_to_system_installed_python
+#export PYFOAM_BIN_DIR=$PYFOAM_DIR/bin
+
+# System installed hwloc
+#export HWLOC_SYSTEM=1
+#export HWLOC_DIR=path_to_system_installed_hwloc
+#export HWLOC_BIN_DIR=$HWLOC_DIR/bin
+
+# System installed Qt
+# This is the only package we assume is system installed by default.
+# So we don't use a variable called QT_SYSTEM, but instead a variable
+# called QT_THIRD_PARTY in order to override to the ThirdParty QT
+# package.
+#
+# If you choose to use the system installed version of QT, keep
+# the variable QT_THIRD_PARTY commented, and uncomment the initialization
+# of the variable QT_DIR and QT_BIN_DIR. Make sure both variables are
+# properly initialized.
+#
+# If you choose instead to use the ThirdParty version of QT, only uncomment
+# the variable QT_THIRD_PARTY and set it to 1. Keep the initialization
+# of the variables QT_DIR nd QT_BIN_DIR commented. The QT ThirdParty scripts
+# will take care of setting the variables QT_DIR and QT_BIN_DIR to the
+# proper values.
+#
+#export QT_THIRD_PARTY=1
+#export QT_DIR=path_to_system_installed_qt
+#export QT_BIN_DIR=$QT_DIR/bin
+
+# System installed ParaView
+#export PARAVIEW_SYSTEM=1
+#export PARAVIEW_DIR=path_to_system_installed_paraview
+#export PARAVIEW_BIN_DIR=$PARAVIEW_DIR/bin
+
+# System installed bison
+#export BISON_SYSTEM=1
+
+# System installed flex
+#export FLEX_SYSTEM=1
+
+# System installed m4
+#export M4_SYSTEM=1
+
+# Specify ParaView version
+# ~~~~~~~~~~~~~~~~~~~~~~~~
+#export ParaView_VERSION=git        # eg, cvs/git version
+#export ParaView_MAJOR=3.7
+
+
+# System identifier for the FOAM CDash test harness on foam-extend
+#
+# By default, your system FQN/hostname will be used as the system identifier
+# when publishing your test harness results on the FOAM CDash server
+# on foam-extend.
+# You can override your identifier using this environment variable
+#export CDASH_SUBMIT_LOCAL_HOST_ID=choose_your_CDash_system_identifer
+
+# Mac OS X MacPorts root directory.
+# The default value is '/opt/local/etc/macports'.
+# In order to disable the usage of MacPorts on Mac OSX, simply initialize this
+# variable to a non-existing directory, or to a dummy value.
+#export MACOSX_MACPORTS_ROOT="_not_using_"
+
+# ThirdParty packages: build control variables
+# ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+# By enabling any of these variables, you will active the compilation and
+# installation of the corresponding ThirdParty package
+#
+# For AllMake.stage1
+#export WM_THIRD_PARTY_USE_GCC_492=1
+#export WM_THIRD_PARTY_USE_GCC_484=1
+#export WM_THIRD_PARTY_USE_GCC_463=1
+#export WM_THIRD_PARTY_USE_GCC_451=1
+#export WM_THIRD_PARTY_USE_GCC_445=1
+#export WM_THIRD_PARTY_USE_PYTHON_27=1
+#export WM_THIRD_PARTY_USE_M4_1416=1
+#export WM_THIRD_PARTY_USE_BISON_27=1
+#export WM_THIRD_PARTY_USE_FLEX_2535=1
+#export WM_THIRD_PARTY_USE_CMAKE_322=1
+
+#
+# For AllMake.stage2
+#export WM_THIRD_PARTY_USE_OPENMPI_184=1
+#export WM_THIRD_PARTY_USE_OPENMPI_184_ConfigureAdditionalArgs='--enable-mpi-cxx --with-openib=/usr --with-openib-libdir=/usr/lib64'
+#export WM_THIRD_PARTY_USE_OPENMPI_165=1
+#export WM_THIRD_PARTY_USE_OPENMPI_165_ConfigureAdditionalArgs='--enable-mpi-cxx --with-openib=/usr --with-openib-libdir=/usr/lib64'
+#export WM_THIRD_PARTY_USE_OPENMPI_15=1
+#export WM_THIRD_PARTY_USE_OPENMPI_143=1
+#export WM_THIRD_PARTY_USE_OPENMPI_141=1
+
+#
+# For AllMake.stage3
+#export WM_THIRD_PARTY_USE_METIS_510=1
+#export WM_THIRD_PARTY_USE_PARMGRIDGEN_10=1
+#export WM_THIRD_PARTY_USE_LIBCCMIO_261=1
+#export WM_THIRD_PARTY_USE_MESQUITE_212=1
+#export WM_THIRD_PARTY_USE_SCOTCH_604=1
+##export WM_THIRD_PARTY_USE_SCOTCH_600=1
+#export WM_THIRD_PARTY_USE_PARMETIS_403=1
+##export WM_THIRD_PARTY_USE_ZOLTAN_36=1
+#export WM_THIRD_PARTY_USE_PYFOAM_064=1
+#export WM_THIRD_PARTY_USE_HWLOC_1101=1
+#export WM_THIRD_PARTY_USE_HWLOC_172=1
+
+#
+# For AllMake.stage4
+#export WM_THIRD_PARTY_USE_QT_486=1
+#export WM_THIRD_PARTY_USE_PARAVIEW_431=1
+#export WM_THIRD_PARTY_USE_PARAVIEW_410=1
+
+
+# Add in preset user preferences: will override site preferences
+#if [ -e $WM_PROJECT_USER_DIR/etc/prefs.sh ]
+#then
+#    _foamSource $WM_PROJECT_USER_DIR/etc/prefs.sh
+#fi
+# ----------------------------------------------------------------- end-of-file

etc/settings.sh

@@ -250,6 +250,12 @@ OPENMPI)
         _foamSource  $WM_THIRD_PARTY_DIR/packages/$mpi_version/platforms/$WM_OPTIONS/etc/$mpi_version.sh
     fi
 
+    # On windows set mpi_version explicitly
+    if [ "$WM_ARCH_BASE" == "mingw" ]
+    then
+        mpi_version=openmpi-1.6.1
+    fi
+
     export FOAM_MPI_LIBBIN=$FOAM_LIBBIN/$mpi_version
     unset mpi_version
     ;;
@@ -498,6 +504,13 @@ esac
 _foamAddLib $FOAM_MPI_LIBBIN
 
 
+# Add DLLs on PATH for Windows (cannot use LD_LIBRARY_PATH)
+# ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+if [ "$WM_ARCH_BASE" == "mingw" ]
+then
+    _foamAddPath $FOAM_LIBBIN $FOAM_LIBBIN/$mpi_version
+fi
+
 # Set the minimum MPI buffer size (used by all platforms except SGI MPI)
 # ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
 minBufferSize=20000000

src/OSspecific/MSWindows/MSwindows.H

@@ -0,0 +1,63 @@
+/*---------------------------------------------------------------------------*\
+    Copyright            : (C) 2011 Symscape
+    Website              : www.symscape.com
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    MSwindows
+
+Description
+
+SourceFiles
+    MSwindows.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef MSwindows_H
+#define MSwindows_H
+
+#include <string>
+
+#include "className.H"
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace MSwindows
+{
+    //- Declare name of the class and it's debug switch
+    NamespaceName("MSwindows");
+
+    //- Get last windows api error from GetLastError
+    std::string getLastError();
+}
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

src/OSspecific/MSWindows/Make/files

@@ -0,0 +1,14 @@
+signals/sigFpe.C
+signals/sigSegv.C
+signals/sigInt.C
+signals/sigQuit.C
+regExp.C
+timer.C
+fileStat.C
+MSwindows.C
+cpuTime/cpuTime.C
+clockTime/clockTime.C
+multiThreader/multiThreader.C
+printStack.C
+
+LIB = $(FOAM_LIBBIN)/libOSspecific

src/OSspecific/MSWindows/clockTime/clockTime.C

@@ -0,0 +1,87 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "clockTime.H"
+#include "scalar.H"
+#include <sys/time.h>
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+// * * * * * * * * * * * * * * * Static Members  * * * * * * * * * * * * * * //
+
+
+// * * * * * * * * * * * * * Private Member Functions  * * * * * * * * * * * //
+
+void clockTime::getTime(struct timeval& t)
+{
+    gettimeofday(&t, NULL);
+}
+
+
+double clockTime::timeDifference
+(
+    const struct timeval& start,
+    const struct timeval& end
+)
+{
+    return end.tv_sec - start.tv_sec + 1E-6*(end.tv_usec - start.tv_usec);
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+clockTime::clockTime()
+{
+    getTime(startTime_);
+    lastTime_ = startTime_;
+    newTime_ = startTime_;
+}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+double clockTime::elapsedTime() const
+{
+    getTime(newTime_);
+    return timeDifference(startTime_, newTime_);
+}
+
+
+double clockTime::timeIncrement() const
+{
+    lastTime_ = newTime_;
+    getTime(newTime_);
+    return timeDifference(lastTime_, newTime_);
+}
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// ************************************************************************* //

src/OSspecific/MSWindows/clockTime/clockTime.H

@@ -0,0 +1,96 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::clockTime
+
+Description
+    Starts timing (using rtc) and returns elapsed time from start.
+    Better resolution (2uSec instead of ~20mSec) than cpuTime.
+
+SourceFiles
+    clockTime.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef clockTime_H
+#define clockTime_H
+
+#include <sys/types.h>
+#include <sys/time.h>
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                           Class clockTime Declaration
+\*---------------------------------------------------------------------------*/
+
+class clockTime
+{
+    // Private data
+
+        struct timeval startTime_;
+        mutable struct timeval lastTime_;
+        mutable struct timeval newTime_;
+
+        static void getTime(struct timeval& t);
+
+        static double timeDifference
+        (
+            const struct timeval& start,
+            const struct timeval& end
+        );
+
+
+public:
+
+    // Constructors
+
+        //- Construct from components
+        clockTime();
+
+
+    // Member Functions
+
+        // Access
+
+            //- Returns CPU time from start of run
+            double elapsedTime() const;
+
+            //- Returns CPU time from last call of clockTimeIncrement()
+            double timeIncrement() const;
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

src/OSspecific/MSWindows/cpuTime/cpuTime.C

@@ -0,0 +1,86 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+Description
+    Starts timing CPU usage and return elapsed time from start.
+
+\*---------------------------------------------------------------------------*/
+
+#include "cpuTime.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+// * * * * * * * * * * * * * Private Member Functions  * * * * * * * * * * * //
+
+void cpuTime::getTime(std::clock_t& t)
+{
+    t = std::clock();
+}
+
+
+double cpuTime::timeDifference
+(
+    const std::clock_t& start,
+    const std::clock_t& end
+)
+{
+    const double difference = std::difftime(end, start) / CLOCKS_PER_SEC;
+    return difference;
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+cpuTime::cpuTime()
+{
+    getTime(startTime_);
+    lastTime_ = startTime_;
+    newTime_ = startTime_;
+}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+double cpuTime::elapsedCpuTime() const
+{
+    getTime(newTime_);
+    return timeDifference(startTime_, newTime_);
+}
+
+
+double cpuTime::cpuTimeIncrement() const
+{
+    lastTime_ = newTime_;
+    getTime(newTime_);
+    return timeDifference(lastTime_, newTime_);
+}
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// ************************************************************************* //

src/OSspecific/MSWindows/cpuTime/cpuTime.H

@@ -0,0 +1,97 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::cpuTime
+
+Description
+    Starts timing CPU usage and return elapsed time from start.
+
+SeeAlso
+    clockTime
+
+SourceFiles
+    cpuTime.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef cpuTime_H
+#define cpuTime_H
+
+#include <ctime>
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                           Class cpuTime Declaration
+\*---------------------------------------------------------------------------*/
+
+class cpuTime
+{
+    // Private data
+
+        std::clock_t startTime_;
+        mutable std::clock_t lastTime_;
+        mutable std::clock_t newTime_;
+
+        static void getTime(std::clock_t& t);
+
+        static double timeDifference
+        (
+            const std::clock_t& start,
+            const std::clock_t& end
+        );
+
+
+public:
+
+    // Constructors
+
+        //- Construct from components
+        cpuTime();
+
+
+    // Member Functions
+
+        // Access
+
+            //- Returns CPU time from start of run
+            double elapsedCpuTime() const;
+
+            //- Returns CPU time from last call of cpuTimeIncrement()
+            double cpuTimeIncrement() const;
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

src/OSspecific/MSWindows/fileStat.C

@@ -0,0 +1,202 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "fileStat.H"
+#include "IOstreams.H"
+#include "timer.H"
+
+#include <unistd.h>
+
+
+
+#undef major
+#undef minor
+#undef makedev
+
+# define major(dev) ((int)(((dev) >> 8) & 0xff))
+# define minor(dev) ((int)((dev) & 0xff))
+# define makedev(major, minor) ((((unsigned int) (major)) << 8) \
+				| ((unsigned int) (minor)))
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+// Construct null
+fileStat::fileStat()
+:
+    isValid_(false)
+{}
+
+
+// Construct from components
+fileStat::fileStat(const fileName& fName, const unsigned int maxTime)
+{
+    // Work on volatile
+    volatile bool locIsValid = false;
+
+    timer myTimer(maxTime);
+
+    if (!timedOut(myTimer))
+    {
+        if (::stat(fName.c_str(), &status_) != 0)
+        {
+            locIsValid = false;
+        }
+        else
+        {
+            locIsValid = true;
+        }
+    }
+
+    // Copy into (non-volatile, possible register based) member var
+    isValid_ = locIsValid;
+}
+
+
+// Construct from Istream.
+fileStat::fileStat(Istream& is)
+{
+    is >> *this;
+}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+// compare two fileStates for same device
+bool fileStat::sameDevice(const fileStat& stat2) const
+{
+    return
+        isValid_
+     && (
+            major(status_.st_dev) == major(stat2.status().st_dev)
+         && minor(status_.st_dev) == minor(stat2.status().st_dev)
+        );
+}
+
+// compare two fileStates for same Inode
+bool fileStat::sameINode(const fileStat& stat2) const
+{
+    return isValid_ && (status_.st_ino == stat2.status().st_ino);
+}
+
+// compare state against inode
+bool fileStat::sameINode(const label iNode) const
+{
+    return isValid_ && (status_.st_ino == ino_t(iNode));
+}
+
+
+// * * * * * * * * * * * * * * * Friend Operators  * * * * * * * * * * * * * //
+
+// Input in list syntax
+Istream& operator>>(Istream& is, fileStat& fStat)
+{
+    // Read beginning of machine info list
+    is.readBegin("fileStat");
+
+    label
+        devMaj, devMin,
+        ino, mode, uid, gid,
+        rdevMaj, rdevMin,
+        size, atime, mtime, ctime;
+
+    is  >> fStat.isValid_
+        >> devMaj
+        >> devMin
+        >> ino
+        >> mode
+        >> uid
+        >> gid
+        >> rdevMaj
+        >> rdevMin
+        >> size
+        >> atime
+        >> mtime
+        >> ctime;
+
+    dev_t st_dev = makedev(devMaj, devMin);
+    fStat.status_.st_dev = st_dev;
+
+    fStat.status_.st_ino = ino;
+    fStat.status_.st_mode = mode;
+    fStat.status_.st_uid = uid;
+    fStat.status_.st_gid = gid;
+
+    dev_t st_rdev = makedev(rdevMaj, rdevMin);
+    fStat.status_.st_rdev = st_rdev;
+
+    fStat.status_.st_size = size;
+    fStat.status_.st_atime = atime;
+    fStat.status_.st_mtime = mtime;
+    fStat.status_.st_ctime = ctime;
+
+    // Read end of machine info list
+    is.readEnd("fileStat");
+
+    // Check state of Istream
+    is.check("Istream& operator>>(Istream&, fileStat&)");
+
+    return is;
+}
+
+
+// Output in list syntax
+Ostream& operator<<(Ostream& os, const fileStat& fStat)
+{
+    // Set precision so 32bit unsigned int can be printed
+    // int oldPrecision = os.precision();
+    int oldPrecision = 0;
+    os.precision(10);
+
+    os  << token::BEGIN_LIST << fStat.isValid_
+        << token::SPACE << label(major(fStat.status_.st_dev))
+        << token::SPACE << label(minor(fStat.status_.st_dev))
+        << token::SPACE << label(fStat.status_.st_ino)
+        << token::SPACE << label(fStat.status_.st_mode)
+        << token::SPACE << label(fStat.status_.st_uid)
+        << token::SPACE << label(fStat.status_.st_gid)
+        << token::SPACE << label(major(fStat.status_.st_rdev))
+        << token::SPACE << label(minor(fStat.status_.st_rdev))
+        << token::SPACE << label(fStat.status_.st_size)
+        << token::SPACE << label(fStat.status_.st_atime)
+        << token::SPACE << label(fStat.status_.st_mtime)
+        << token::SPACE << label(fStat.status_.st_ctime)
+        << token::END_LIST;
+
+    os.precision(oldPrecision);
+    return os;
+}
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// ************************************************************************* //

src/OSspecific/MSWindows/fileStat.H

@@ -0,0 +1,125 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::fileStat
+
+Description
+    Wrapper for stat() system call.
+
+Warning
+    on Linux (an maybe on others) a stat() of an nfs mounted (remote)
+    file does never timeout and cannot be interrupted!
+    So e.g. Foam::ping first and hope nfs is running.
+
+SourceFiles
+    fileStat.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef fileStat_H
+#define fileStat_H
+
+#include <sys/stat.h>
+#include <sys/types.h>
+
+#include "label.H"
+#include "fileName.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                           Class fileStat Declaration
+\*---------------------------------------------------------------------------*/
+
+class fileStat
+{
+    // Private data
+
+        struct stat status_;
+
+        bool isValid_;
+
+
+public:
+
+    // Constructors
+
+        //- Empty constructor
+        fileStat();
+
+        //- Construct from components
+        fileStat(const fileName& fName, const unsigned int maxTime=0);
+
+        //- Construct from Istream
+        fileStat(Istream&);
+
+
+    // Member Functions
+
+        // Access
+
+            //- Raw status
+            const struct stat& status() const
+            {
+                return status_;
+            }
+
+            //- Did constructor fail
+            bool isValid() const
+            {
+                return isValid_;
+            }
+
+
+        // Check
+
+            //- compare two fileStats for same device
+            bool sameDevice(const fileStat& stat2) const;
+
+            //- compare two fileStats for same Inode
+            bool sameINode(const fileStat& stat2) const;
+
+            //- compare state against inode
+            bool sameINode(const label iNode) const;
+
+
+    // IOstream Operators
+
+        friend Istream& operator>>(Istream&, fileStat&);
+        friend Ostream& operator<<(Ostream&, const fileStat&);
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

src/OSspecific/MSWindows/multiThreader/multiThreader.C

@@ -0,0 +1,707 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    multiThreader
+
+Description
+    Implementation of the multiThreader class
+
+Author
+    Sandeep Menon
+    University of Massachusetts Amherst
+
+\*----------------------------------------------------------------------------*/
+
+#include "multiThreader.H"
+
+namespace Foam
+{
+
+// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
+
+defineTypeNameAndDebug(IOmultiThreader, 0);
+
+bool multiThreader::debug = false;
+bool Mutex::debug = false;
+bool rwMutex::debug = false;
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+multiThreader::multiThreader(int numThreads)
+:
+    maxQueueSize_(10),
+    poolInfo_(NULL)
+{
+    if (numThreads > 0)
+    {
+        numThreads_ = numThreads;
+
+        if (debug)
+        {
+            Info << "Initializing threading environment with "
+                 << numThreads_ << " threads." << endl;
+        }
+    }
+    else
+    {
+        // Default number of threads at one (single-threaded)
+        numThreads_ = 1;
+
+        if (debug)
+        {
+            Info << "Defaulting threading environment to one thread." << endl;
+        }
+    }
+
+    // Initialize the thread pool
+    initializeThreadPool();
+}
+
+
+Mutex::Mutex()
+{
+    // Set attributes based on debug flag
+    pthread_mutexattr_t attribute;
+    pthread_mutexattr_init(&attribute);
+
+    if (debug)
+    {
+        pthread_mutexattr_settype(&attribute, PTHREAD_MUTEX_ERRORCHECK);
+    }
+    else
+    {
+        pthread_mutexattr_settype(&attribute, PTHREAD_MUTEX_NORMAL);
+    }
+
+    if (pthread_mutex_init(&lock_, &attribute))
+    {
+        FatalErrorIn("multiThreader::Mutex::Mutex()")
+            << "Unable to initialize mutex"
+            << abort(FatalError);
+    }
+
+    // Destroy the attribute
+    pthread_mutexattr_destroy(&attribute);
+}
+
+
+rwMutex::rwMutex()
+{
+    // Set attributes for the mutex
+    pthread_rwlockattr_t attribute;
+    pthread_rwlockattr_init(&attribute);
+
+    if (pthread_rwlock_init(&lock_, &attribute))
+    {
+        FatalErrorIn("multiThreader::rwMutex::rwMutex()")
+            << "Unable to initialize read-write mutex"
+            << abort(FatalError);
+    }
+
+    // Destroy the attribute
+    pthread_rwlockattr_destroy(&attribute);
+}
+
+
+Conditional::Conditional()
+{
+    if (pthread_cond_init(&condition_, NULL))
+    {
+        FatalErrorIn("multiThreader::Conditional::Conditional()")
+            << "Unable to initialize condition"
+            << abort(FatalError);
+    }
+}
+
+// * * * * * * * * * * * * * * * * Destructors * * * * * * * * * * * * * * * //
+
+multiThreader::~multiThreader()
+{
+    destroyThreadPool();
+}
+
+
+Mutex::~Mutex()
+{
+    if (pthread_mutex_destroy(&lock_))
+    {
+        FatalErrorIn("multiThreader::Mutex::~Mutex()")
+            << "Unable to destroy mutex"
+            << abort(FatalError);
+    }
+}
+
+
+rwMutex::~rwMutex()
+{
+    if (pthread_rwlock_destroy(&lock_))
+    {
+        FatalErrorIn("multiThreader::rwMutex::~rwMutex()")
+            << "Unable to destroy read-write mutex"
+            << abort(FatalError);
+    }
+}
+
+
+Conditional::~Conditional()
+{
+    if (pthread_cond_destroy(&condition_))
+    {
+        FatalErrorIn("multiThreader::Conditional::~Conditional()")
+            << "Unable to destroy condition"
+            << abort(FatalError);
+    }
+}
+
+
+// * * * * * * * * * * * * * * * Private Functions * * * * * * * * * * * * * //
+
+void multiThreader::initializeThreadPool()
+{
+    // Initialize threads only if multi-threaded
+    if (multiThreaded())
+    {
+        // Allocate the threadPool structure
+        poolInfo_ = new threadPool;
+
+        // Initialize fields
+        poolInfo_->threader = this;
+        poolInfo_->numThreads = numThreads_;
+        poolInfo_->queueSize = 0;
+        poolInfo_->threads = new pthread_t[numThreads_];
+        poolInfo_->head = NULL;
+        poolInfo_->tail = NULL;
+
+        // Initialize flags
+        poolInfo_->queueClosed = false;
+        poolInfo_->shutDown = false;
+
+        // Initialize thread attributes
+        pthread_attr_init(&(poolInfo_->attr));
+        pthread_attr_setdetachstate
+        (
+            &(poolInfo_->attr),
+            PTHREAD_CREATE_JOINABLE
+        );
+
+        // Create worker threads and have them wait for jobs
+        for (int tIndex = 0; tIndex < numThreads_; tIndex++)
+        {
+            int status = pthread_create
+                         (
+                             &(poolInfo_->threads[tIndex]),
+                             &(poolInfo_->attr),
+                             reinterpret_cast<externThreadFunctionType>
+                             (
+                                 poolThread
+                             ),
+                             reinterpret_cast<void *>
+                             (
+                                 poolInfo_
+                             )
+                         );
+
+            if (status != 0)
+            {
+                FatalErrorIn("multiThreader::initializeThreadPool()")
+                    << "pthread_create could not initialize thread: "
+                    << tIndex
+                    << abort(FatalError);
+            }
+        }
+    }
+}
+
+
+threadReturnType multiThreader::poolThread(void *arg)
+{
+    // Typecast the argument into the required structure
+    threadPool *poolInfo = reinterpret_cast<threadPool *>(arg);
+
+    // Work queue loop
+    while (true)
+    {
+        // Lock the work queue
+        poolInfo->queueLock.lock();
+
+        // Wait for work to arrive in the queue
+        while ((poolInfo->queueSize == 0) && (!poolInfo->shutDown))
+        {
+#           ifdef FULLDEBUG
+            if (debug)
+            {
+                Info << "poolThread::Wait on queueNotEmpty." << endl;
+            }
+#           endif
+            poolInfo->threader->waitForCondition
+                                (
+                                    poolInfo->queueNotEmpty,
+                                    poolInfo->queueLock
+                                );
+        }
+
+        // Check for shutdown
+        if (poolInfo->shutDown)
+        {
+            poolInfo->queueLock.unlock();
+            pthread_exit(NULL);
+        }
+
+        // Pick an item off the queue, and get to work
+        workQueueItem *myWorkItem = poolInfo->head;
+        poolInfo->queueSize--;
+        if (poolInfo->queueSize == 0)
+        {
+            poolInfo->head = poolInfo->tail = NULL;
+        }
+        else
+        {
+            poolInfo->head = myWorkItem->next;
+        }
+
+        // Handle a waiting destructor
+        if (poolInfo->queueSize == 0)
+        {
+#           ifdef FULLDEBUG
+            if (debug)
+            {
+                Info << "poolThread::Signaling: Empty queue." << endl;
+            }
+#           endif
+            poolInfo->threader->signal(poolInfo->queueEmpty);
+        }
+
+        // Unlock the work queue
+        poolInfo->queueLock.unlock();
+
+        // Perform the work
+        myWorkItem->function(myWorkItem->arg);
+
+        // Free up the work item
+        delete myWorkItem;
+    }
+
+    return threadReturnValue;
+}
+
+
+void multiThreader::addToWorkQueue
+(
+    void (*tFunction)(void*),
+    void *arg
+) const
+{
+    if (singleThreaded())
+    {
+#       ifdef FULLDEBUG
+        if (debug)
+        {
+            Info << "addToWorkQueue:: Not in multiThreaded mode." << endl;
+        }
+#       endif
+
+        return;
+    }
+
+    // Lock the work queue
+    poolInfo_->queueLock.lock();
+
+    // If occupied, wait for the queue to free-up
+    while
+    (
+         (poolInfo_->queueSize == maxQueueSize_)
+      && (!(poolInfo_->shutDown || poolInfo_->queueClosed))
+    )
+    {
+#       ifdef FULLDEBUG
+        if (debug)
+        {
+            Info << "addToWorkQueue:: Wait on queueNotFull." << endl;
+        }
+#       endif
+        waitForCondition(poolInfo_->queueNotFull, poolInfo_->queueLock);
+    }
+
+    // Is the pool in the process of being destroyed?
+    // Unlock the mutex and return to caller.
+    if (poolInfo_->shutDown || poolInfo_->queueClosed)
+    {
+        poolInfo_->queueLock.unlock();
+        return;
+    }
+
+    // Allocate a new work structure
+    workQueueItem *newWorkItem = new workQueueItem;
+    newWorkItem->function = tFunction;
+    newWorkItem->arg = arg;
+    newWorkItem->next = NULL;
+
+    // Add new work structure to the queue
+    if (poolInfo_->queueSize == 0)
+    {
+        poolInfo_->tail = poolInfo_->head = newWorkItem;
+        broadCast(poolInfo_->queueNotEmpty);
+    }
+    else
+    {
+        poolInfo_->tail->next = newWorkItem;
+        poolInfo_->tail = newWorkItem;
+    }
+
+    poolInfo_->queueSize++;
+
+    // Unlock the work queue
+    poolInfo_->queueLock.unlock();
+}
+
+
+void multiThreader::destroyThreadPool()
+{
+    // Destroy threads only if multi-threaded
+    if (multiThreaded())
+    {
+        // Lock the work queue
+        poolInfo_->queueLock.lock();
+
+        // Is a shutdown already in progress?
+        if (poolInfo_->queueClosed || poolInfo_->shutDown)
+        {
+            // Unlock the mutex and return
+            poolInfo_->queueLock.unlock();
+            return;
+        }
+
+        poolInfo_->queueClosed = true;
+
+        // Wait for workers to drain the queue
+        while (poolInfo_->queueSize != 0)
+        {
+            waitForCondition(poolInfo_->queueEmpty, poolInfo_->queueLock);
+        }
+
+        poolInfo_->shutDown = true;
+
+        // Unlock the work queue
+        poolInfo_->queueLock.unlock();
+
+        // Wake up workers so that they check the shutdown flag
+        broadCast(poolInfo_->queueNotEmpty);
+        broadCast(poolInfo_->queueNotFull);
+
+        // Wait for all workers to exit
+        for(int i=0; i < numThreads_; i++)
+        {
+            if (pthread_join(poolInfo_->threads[i],NULL))
+            {
+                FatalErrorIn("multiThreader::destroyThreadPool()")
+                    << "pthread_join failed."
+                    << abort(FatalError);
+            }
+        }
+
+        // Destroy the attribute
+        pthread_attr_destroy(&(poolInfo_->attr));
+
+        // Deallocate the work-queue and pool structure
+        delete [] poolInfo_->threads;
+
+        workQueueItem *currentNode;
+        while(poolInfo_->head != NULL)
+        {
+            currentNode = poolInfo_->head->next;
+            poolInfo_->head = poolInfo_->head->next;
+            delete currentNode;
+        }
+
+        delete poolInfo_;
+    }
+}
+
+
+void multiThreader::waitForCondition
+(
+    Conditional& condition,
+    Mutex& mutex
+) const
+{
+    if (pthread_cond_wait(condition(),mutex()))
+    {
+        FatalErrorIn("multiThreader::waitForCondition()")
+            << "Conditional wait failed."
+            << abort(FatalError);
+    }
+}
+
+
+void multiThreader::broadCast(Conditional& condition) const
+{
+    if (pthread_cond_broadcast(condition()))
+    {
+        FatalErrorIn("multiThreader::broadCast()")
+            << "Unable to broadcast."
+            << abort(FatalError);
+    }
+}
+
+
+void multiThreader::signal(Conditional& condition) const
+{
+    if (pthread_cond_signal(condition()))
+    {
+        FatalErrorIn("multiThreader::signal()")
+            << "Unable to signal."
+            << abort(FatalError);
+    }
+}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+//- Return the number of threads
+int multiThreader::getNumThreads() const
+{
+    return numThreads_;
+}
+
+
+//- Obtain the thread ID for a given index
+pthread_t multiThreader::getID(int index) const
+{
+    if (multiThreaded())
+    {
+        if (poolInfo_ && index > -1 && index < numThreads_)
+        {
+            return poolInfo_->threads[index];
+        }
+        else
+        {
+            FatalErrorIn("multiThreader::getID(int index)")
+                << "Invalid request for ID."
+                << abort(FatalError);
+        }
+    }
+
+    return pthread_self();
+}
+
+
+//- Return true if the number of threads is equal to one.
+bool multiThreader::singleThreaded() const
+{
+    return (numThreads_ == 1);
+}
+
+
+//- Return true if the number of threads is more than one.
+bool multiThreader::multiThreaded() const
+{
+    return (numThreads_ > 1);
+}
+
+
+//- Return the maxQueueSize
+int multiThreader::getMaxQueueSize() const
+{
+    return maxQueueSize_;
+}
+
+
+//- Set the maxQueueSize
+void multiThreader::setMaxQueueSize(int size) const
+{
+    if (size > 0)
+    {
+        maxQueueSize_ = size;
+    }
+    else
+    {
+        FatalErrorIn("multiThreader::setMaxQueueSize(int size)")
+            << "Improper value for MaxQueueSize."
+            << abort(FatalError);
+    }
+}
+
+
+void Mutex::lock() const
+{
+    if (pthread_mutex_lock(&lock_))
+    {
+        FatalErrorIn("multiThreader::Mutex::lock()")
+            << "Unable to lock mutex."
+            << abort(FatalError);
+    }
+}
+
+
+bool Mutex::tryLock() const
+{
+    label retVal;
+
+    if ((retVal = pthread_mutex_trylock(&lock_)) != 0)
+    {
+#       ifdef FULLDEBUG
+        if (debug)
+        {
+            if (retVal == EINVAL)
+            {
+                FatalErrorIn("multiThreader::Mutex::trylock()")
+                    << "Mutex returned EINVAL."
+                    << abort(FatalError);
+            }
+            if (retVal == EFAULT)
+            {
+                FatalErrorIn("multiThreader::Mutex::trylock()")
+                    << "Mutex returned EFAULT."
+                    << abort(FatalError);
+            }
+        }
+#       endif
+    }
+
+    return retVal;
+}
+
+
+void Mutex::unlock() const
+{
+    if (pthread_mutex_unlock(&lock_))
+    {
+        FatalErrorIn("multiThreader::Mutex::unlock()")
+            << "Unable to unlock the mutex."
+            << abort(FatalError);
+    }
+}
+
+
+void rwMutex::lock(const lockType lType) const
+{
+    if (lType == READ_LOCK)
+    {
+        if (pthread_rwlock_rdlock(&lock_))
+        {
+            FatalErrorIn("multiThreader::rwMutex::lock()")
+                << "Unable to read lock the mutex."
+                << abort(FatalError);
+        }
+    }
+    else
+    if (lType == WRITE_LOCK)
+    {
+        if (pthread_rwlock_wrlock(&lock_))
+        {
+            FatalErrorIn("multiThreader::rwMutex::lock()")
+                << "Unable to write lock the mutex."
+                << abort(FatalError);
+        }
+    }
+    else
+    {
+        FatalErrorIn("multiThreader::rwMutex::lock()")
+            << "Undefined mutex type."
+            << abort(FatalError);
+    }
+}
+
+
+bool rwMutex::tryLock(const lockType lType) const
+{
+    label retVal = -1;
+
+    if (lType == READ_LOCK)
+    {
+        if ((retVal = pthread_rwlock_tryrdlock(&lock_)) != 0)
+        {
+            if (retVal == EINVAL)
+            {
+                FatalErrorIn("multiThreader::rwMutex::tryLock()")
+                    << "Read mutex returned EINVAL."
+                    << abort(FatalError);
+            }
+
+            if (retVal == EFAULT)
+            {
+                FatalErrorIn("multiThreader::rwMutex::tryLock()")
+                    << "Read mutex returned EFAULT."
+                    << abort(FatalError);
+            }
+        }
+    }
+    else
+    if (lType == WRITE_LOCK)
+    {
+        if ((retVal = pthread_rwlock_trywrlock(&lock_)) != 0)
+        {
+            if (retVal == EINVAL)
+            {
+                FatalErrorIn("multiThreader::rwMutex::tryLock()")
+                    << "Write mutex returned EINVAL."
+                    << abort(FatalError);
+            }
+
+            if (retVal == EFAULT)
+            {
+                FatalErrorIn("multiThreader::rwMutex::tryLock()")
+                    << "Write mutex returned EFAULT."
+                    << abort(FatalError);
+            }
+        }
+    }
+    else
+    {
+        FatalErrorIn("multiThreader::rwMutex::tryLock()")
+            << "Undefined mutex type."
+            << abort(FatalError);
+    }
+
+    return retVal;
+}
+
+
+void rwMutex::unlock() const
+{
+    if (pthread_rwlock_unlock(&lock_))
+    {
+        FatalErrorIn("multiThreader::rwMutex::unlock()")
+            << "Unable to unlock the read-write mutex."
+            << abort(FatalError);
+    }
+}
+
+
+// * * * * * * * * * * * * * * * Member Operators  * * * * * * * * * * * * * //
+
+void multiThreader::operator=(const multiThreader& rhs)
+{
+    // Check for assignment to self
+    if (this == &rhs)
+    {
+        FatalErrorIn("multiThreader::operator=(const multiThreader&)")
+            << "Attempted assignment to self"
+            << abort(FatalError);
+    }
+}
+
+} // End namespace Foam
+
+// ************************************************************************* //

src/OSspecific/MSWindows/multiThreader/multiThreader.H

@@ -0,0 +1,324 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    multiThreader
+
+Description
+    Class which provides support for generic multi-threaded execution of class
+    methods using POSIX threads.
+
+    The IOmultiThreader is an inherited class which allows integration with
+    the object registry, thereby allowing a single multi-threader object to
+    be accessed by multiple classes in a global sense.
+
+    Thread-pooling is implemented as described in:
+   "Using POSIX Threads: Programming with Pthreads"
+    by Brad Nichols, Dick Buttlar, Jackie Farrell
+      O'Reilly & Associates, Inc.
+
+Author
+    Sandeep Menon
+    University of Massachusetts Amherst
+
+SourceFiles
+    multiThreader.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef multiThreader_H
+#define multiThreader_H
+
+#include "error.H"
+#include "regIOobject.H"
+
+#include <pthread.h>
+#include <errno.h>
+#include <sys/types.h>
+#include <unistd.h>
+
+extern "C"
+{
+    typedef void *(*externThreadFunctionType)(void *);
+}
+
+typedef void *(*threadFunctionType)(void *);
+
+#define threadReturnType void *
+#define threadReturnValue NULL
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+class Mutex
+{
+    // Private data
+
+        mutable pthread_mutex_t lock_;
+
+public:
+
+    // Debug switch
+    static bool debug;
+
+    // Constructor
+    Mutex();
+
+    // Destructor
+    ~Mutex();
+
+    // Lock the mutex
+    void lock() const;
+
+    // Try to acquire the mutex.
+    // Returns zero if successful
+    bool tryLock() const;
+
+    // Unlock the mutex
+    void unlock() const;
+
+    // Operator overload
+    inline pthread_mutex_t* operator()()
+    {
+        return &lock_;
+    }
+};
+
+class rwMutex
+{
+    // Private data
+
+        mutable pthread_rwlock_t lock_;
+
+public:
+
+    // Enumerants for lock-types
+    enum lockType
+    {
+        READ_LOCK,
+        WRITE_LOCK
+    };
+
+    // Debug switch
+    static bool debug;
+
+    // Constructor
+    rwMutex();
+
+    // Destructor
+    ~rwMutex();
+
+    // Lock the mutex
+    void lock(const lockType lType) const;
+
+    // Try to acquire a lock
+    bool tryLock(const lockType lType) const;
+
+    // Unlock the mutex
+    void unlock() const;
+
+    // Operator overload
+    inline pthread_rwlock_t* operator()()
+    {
+        return &lock_;
+    }
+};
+
+class Conditional
+{
+    // Private data
+
+        mutable pthread_cond_t condition_;
+
+public:
+
+    // Constructor
+    Conditional();
+
+    // Destructor
+    ~Conditional();
+
+    // Operator overload
+    inline pthread_cond_t* operator()()
+    {
+        return &condition_;
+    }
+};
+
+/*---------------------------------------------------------------------------*\
+                           Class multiThreader Declaration
+\*---------------------------------------------------------------------------*/
+
+class multiThreader
+{
+    // Private data
+
+        mutable int numThreads_;
+
+        mutable int maxQueueSize_;
+
+        // Work-queue item: Holds a pointer to the method and its argument
+        struct workQueueItem
+        {
+            void (*function)(void*);
+            void *arg;
+            workQueueItem *next;
+        };
+
+        // Common structure for all threads in the pool.
+        mutable struct threadPool
+        {
+            multiThreader *threader;
+            int numThreads;
+            int queueSize;
+            pthread_t *threads;
+            pthread_attr_t attr;
+            workQueueItem *head, *tail;
+
+            // Flags
+            bool queueClosed;
+            bool shutDown;
+
+            // Synchronization
+            Mutex queueLock;
+            Conditional queueNotEmpty;
+            Conditional queueNotFull;
+            Conditional queueEmpty;
+        } *poolInfo_;
+
+    // Private Member Functions
+
+        void initializeThreadPool();
+
+        static threadReturnType poolThread(void *arg);
+
+        void destroyThreadPool();
+
+        //- Disallow default bitwise copy construct
+        multiThreader(const multiThreader&);
+
+        //- Disallow default bitwise assignment
+        void operator=(const multiThreader&);
+
+public:
+
+    // Debug switch
+
+        static bool debug;
+
+    // Constructor
+
+        //- Construct with specified number of threads
+        multiThreader(int numThreads);
+
+
+    // Destructor
+
+        ~multiThreader();
+
+
+    // Member Functions
+
+        //- Return the number of threads
+        int getNumThreads() const;
+
+        //- Obtain the thread ID for a given index
+        pthread_t getID(int index) const;
+
+        //- Return true if the number of threads is equal to one.
+        bool singleThreaded() const;
+
+        //- Return true if the number of threads is more than one.
+        bool multiThreaded() const;
+
+        //- Return the maxQueueSize
+        int getMaxQueueSize() const;
+
+        //- Set the maxQueueSize
+        void setMaxQueueSize(int size) const;
+
+        //- Add a function to the work queue
+        void addToWorkQueue(void (*tFunction)(void*), void *arg) const;
+
+        //- Conditional handling
+        void waitForCondition(Conditional&, Mutex&) const;
+        void broadCast(Conditional&) const;
+        void signal(Conditional&) const;
+};
+
+/*---------------------------------------------------------------------------*\
+                         Class IOmultiThreader Declaration
+\*---------------------------------------------------------------------------*/
+
+class IOmultiThreader
+:
+    public regIOobject,
+    public multiThreader
+{
+
+    // Member functions
+
+        //- Disallow default bitwise copy construct
+        IOmultiThreader(const IOmultiThreader&);
+
+        //- Disallow default bitwise assignment
+        void operator=(const IOmultiThreader&);
+
+public:
+
+    //- Runtime type information
+    TypeName("multiThreader");
+
+
+    // Constructors
+
+        //- Construct from IOobject and specified number of threads
+        IOmultiThreader(const IOobject& io, int numThreads)
+        :
+            regIOobject(io),
+            multiThreader(numThreads)
+        {}
+
+    // Destructor
+
+        virtual ~IOmultiThreader() {}
+
+    // Member functions
+
+        bool writeData(Ostream&) const
+        {
+            return true;
+        }
+};
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

src/OSspecific/MSWindows/multiThreader/threadHandler.H

@@ -0,0 +1,214 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    threadHandler
+
+Description
+    Helper class used to assist in multi-threading and synchronization.
+
+    Use this class to pass information to a threaded static member-function
+    belonging to the class T.
+
+Author
+    Sandeep Menon
+    University of Massachusetts Amherst
+    All rights reserved
+
+SourceFiles
+    threadHandlerI.H
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef threadHandler_H
+#define threadHandler_H
+
+#include "FixedList.H"
+#include "List.H"
+#include "multiThreader.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                           Class threadHandler Declaration
+\*---------------------------------------------------------------------------*/
+
+template<class T>
+class threadHandler
+{
+    // Reference to the template class
+    T& tRef_;
+
+    // Reference to the multiThreader class
+    const multiThreader& threader_;
+
+    // List of function argument pointers
+    List<void *> argList_;
+
+    // Total number of threads
+    const label nThreads_;
+
+    // ID generated by the pthreads API
+    pthread_t pthreadID_;
+
+    // Is this a master/slave thread
+    mutable bool master_;
+
+    // Synchronization mutexes
+    mutable Mutex startMutex_;
+    mutable Mutex stopMutex_;
+
+    // Conditionals for synchronization
+    mutable Conditional startConditional_;
+    mutable Conditional stopConditional_;
+
+    // On some implementations, a conditional wait
+    // might return prematurely due to a spurious
+    // wake-up signal. Use a predicate to avoid this
+    // behaviour.
+    mutable FixedList<bool, 2> predicate_;
+
+public:
+
+    // Enumerants for signalling
+    enum signalType
+    {
+        START,
+        STOP
+    };
+
+    // Constructor
+    threadHandler
+    (
+        T& tPtr,
+        const multiThreader& threader
+    );
+
+    // Destructor
+    ~threadHandler();
+
+    // Return a reference to the template class
+    inline T& reference();
+
+    // Set a size for the argument list
+    inline void setSize(const label size);
+
+    // Set a argument pointer for a particular index
+    inline void set(const label index, void* argPtr);
+
+    // Return a reference to the multiThreader
+    inline const multiThreader& threader() const;
+
+    // Return the number of threads
+    inline label nThreads() const;
+
+    // Designate as master thread
+    inline void setMaster() const;
+
+    // Designate as slave thread
+    inline void setSlave() const;
+
+    // Is this a master thread?
+    inline bool master() const;
+
+    // Is this a slave thread?
+    inline bool slave() const;
+
+    // Lock this thread
+    inline void lock(const signalType sType) const;
+
+    // Unlock this thread
+    inline void unlock(const signalType sType) const;
+
+    // Send signal to a waiting conditional
+    inline void sendSignal(const signalType sType) const;
+
+    // Wait for signal
+    inline void waitForSignal(const signalType sType) const;
+
+    // Return state of the predicate variable
+    inline bool predicate(const signalType sType) const;
+
+    // Set the predicate variable
+    inline void setPredicate(const signalType sType) const;
+
+    // Unset the predicate variable
+    inline void unsetPredicate(const signalType sType) const;
+
+    // Set the ID
+    inline void setID(const pthread_t& pt);
+
+    // Return the ID
+    inline pthread_t ID() const;
+
+    // Does the calling thread correspond to this handler?
+    inline bool self() const;
+
+    // Return an argument pointer at a particular index
+    inline void * operator()(const label index);
+};
+
+
+// Lock all threads provided by sequence
+template <class T>
+void lockThreads
+(
+    const List<label>& sequence,
+    const PtrList<threadHandler<T> >& handler
+);
+
+
+// Synchronize all threads provided by sequence
+template <class T>
+void synchronizeThreads
+(
+    const List<label>& sequence,
+    const PtrList<threadHandler<T> >& handler
+);
+
+
+// Execute threads for the submitted static function by sequence
+template <class T>
+void executeThreads
+(
+    const List<label>& sequence,
+    PtrList<threadHandler<T> >& handler,
+    void (*tFunction)(void*)
+);
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#include "threadHandlerI.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

src/OSspecific/MSWindows/multiThreader/threadHandlerI.H

@@ -0,0 +1,467 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+// Constructor for threadHandler
+template<class T>
+threadHandler<T>::threadHandler
+(
+    T& tRef,
+    const multiThreader& threader
+)
+:
+    tRef_(tRef),
+    threader_(threader),
+    argList_(0),
+    nThreads_(threader.getNumThreads()),
+    pthreadID_(pthread_self()),
+    master_(false),
+    predicate_(false)
+{}
+
+
+// * * * * * * * * * * * * * * * *  Destructors  * * * * * * * * * * * * * * //
+
+template<class T>
+threadHandler<T>::~threadHandler()
+{
+    // Null the argument list pointer copies
+    // to avoid multiple deallocations.
+    forAll(argList_, indexI)
+    {
+        argList_[indexI] = NULL;
+    }
+}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+// Return a reference to the template class
+template<class T>
+inline T& threadHandler<T>::reference()
+{
+    return tRef_;
+}
+
+
+// Set a size for the argument list
+template<class T>
+inline void threadHandler<T>::setSize
+(
+    const label size
+)
+{
+    argList_.setSize(size, NULL);
+}
+
+
+// Set a argument pointer for a particular index
+template<class T>
+inline void threadHandler<T>::set
+(
+    const label index,
+    void* argPtr
+)
+{
+    if (!argList_.size())
+    {
+        FatalErrorIn("threadHandler<T>::set")
+            << "Attempt to access element from zero sized list"
+            << abort(FatalError);
+    }
+    else
+    if (index < 0 || index >= argList_.size())
+    {
+        FatalErrorIn("threadHandler<T>::set")
+            << "index " << index << " out of range 0 ... "
+            << argList_.size()-1
+            << abort(FatalError);
+    }
+
+    argList_[index] = argPtr;
+}
+
+
+// Return a reference to the multiThreader
+template<class T>
+inline const multiThreader& threadHandler<T>::threader() const
+{
+    return threader_;
+}
+
+
+// Return the number of threads
+template<class T>
+inline label threadHandler<T>::nThreads() const
+{
+    return nThreads_;
+}
+
+
+// Designate as master thread
+template<class T>
+inline void threadHandler<T>::setMaster() const
+{
+    master_ = true;
+}
+
+
+// Designate as slave thread
+template<class T>
+inline void threadHandler<T>::setSlave() const
+{
+    master_ = false;
+}
+
+
+// Is this a master thread?
+template<class T>
+inline bool threadHandler<T>::master() const
+{
+    return (master_ == true);
+}
+
+
+// Is this a slave thread?
+template<class T>
+inline bool threadHandler<T>::slave() const
+{
+    return !master();
+}
+
+
+// Lock this thread
+template<class T>
+inline void threadHandler<T>::lock
+(
+    const signalType sType
+) const
+{
+    if (sType == START)
+    {
+        startMutex_.lock();
+    }
+    else
+    if (sType == STOP)
+    {
+        stopMutex_.lock();
+    }
+}
+
+
+// Unlock this thread
+template<class T>
+inline void threadHandler<T>::unlock
+(
+    const signalType sType
+) const
+{
+    if (sType == START)
+    {
+        startMutex_.unlock();
+    }
+    else
+    if (sType == STOP)
+    {
+        stopMutex_.unlock();
+    }
+}
+
+
+// Send signal to a waiting conditional
+template<class T>
+inline void threadHandler<T>::sendSignal
+(
+    const signalType sType
+) const
+{
+    lock(sType);
+
+    if (predicate(sType))
+    {
+        InfoIn("threadHandler::sendSignal()")
+            << "Predicate is already set."
+            << endl;
+    }
+    else
+    {
+        // Set predicate before signalling
+        setPredicate(sType);
+    }
+
+    if (sType == START)
+    {
+        threader().signal
+        (
+            startConditional_
+        );
+    }
+    else
+    if (sType == STOP)
+    {
+        threader().signal
+        (
+            stopConditional_
+        );
+    }
+    else
+    {
+        FatalErrorIn("threadHandler::sendSignal()")
+            << "Undefined enumerant."
+            << abort(FatalError);
+    }
+
+    unlock(sType);
+}
+
+
+// Wait for signal
+template<class T>
+inline void threadHandler<T>::waitForSignal
+(
+    const signalType sType
+) const
+{
+    if (sType == START)
+    {
+        threader().waitForCondition
+        (
+            startConditional_,
+            startMutex_
+        );
+    }
+    else
+    if (sType == STOP)
+    {
+        threader().waitForCondition
+        (
+            stopConditional_,
+            stopMutex_
+        );
+    }
+    else
+    {
+        FatalErrorIn("threadHandler::waitForSignal()")
+            << "Undefined enumerant."
+            << abort(FatalError);
+    }
+
+    if (!predicate(sType))
+    {
+        FatalErrorIn("threadHandler::waitForSignal()")
+            << "Spurious wake-up."
+            << abort(FatalError);
+    }
+
+    unsetPredicate(sType);
+
+    // Unlock the acquired mutex
+    unlock(sType);
+}
+
+
+// Return state of the predicate variable
+template<class T>
+inline bool threadHandler<T>::predicate
+(
+    const signalType sType
+) const
+{
+    return predicate_[sType];
+}
+
+
+// Set the predicate variable
+template<class T>
+inline void threadHandler<T>::setPredicate
+(
+    const signalType sType
+) const
+{
+    predicate_[sType] = true;
+}
+
+
+// Unset the predicate variable
+template<class T>
+inline void threadHandler<T>::unsetPredicate
+(
+    const signalType sType
+) const
+{
+    predicate_[sType] = false;
+}
+
+
+// Return the ID
+template<class T>
+inline void threadHandler<T>::setID(const pthread_t& pt)
+{
+    pthreadID_ = pt;
+}
+
+
+// Return the ID
+template<class T>
+inline pthread_t threadHandler<T>::ID() const
+{
+    return pthreadID_;
+}
+
+
+// Does the calling thread correspond to this handler?
+template<class T>
+inline bool threadHandler<T>::self() const
+{
+    return pthread_equal(ID(), pthread_self());
+}
+
+
+// Return an argument pointer at a particular index
+template<class T>
+inline void * threadHandler<T>::operator()
+(
+    const label index
+)
+{
+    if (!argList_.size())
+    {
+        FatalErrorIn("threadHandler<T>::operator()")
+            << "Attempt to access element from zero sized list"
+            << abort(FatalError);
+    }
+    else
+    if (index < 0 || index >= argList_.size())
+    {
+        FatalErrorIn("threadHandler<T>::operator()")
+            << "index " << index << " out of range 0 ... "
+            << argList_.size()-1
+            << abort(FatalError);
+    }
+    else
+    if (!argList_[index])
+    {
+        FatalErrorIn("threadHandler<T>::operator()")
+            << "Hanging pointer. This is not allowed."
+            << abort(FatalError);
+    }
+
+    return argList_[index];
+}
+
+
+// * * * * * * * * * * * * * * * Global Functions  * * * * * * * * * * * * * //
+
+// Lock all threads provided by sequence
+template <class T>
+void lockThreads
+(
+    const List<label>& sequence,
+    const PtrList<threadHandler<T> >& handler
+)
+{
+    forAll(sequence, i)
+    {
+        handler[sequence[i]].lock(threadHandler<T>::START);
+        handler[sequence[i]].lock(threadHandler<T>::STOP);
+
+        handler[sequence[i]].unsetPredicate(threadHandler<T>::START);
+        handler[sequence[i]].unsetPredicate(threadHandler<T>::STOP);
+    }
+}
+
+
+// Synchronize all threads provided by sequence
+template <class T>
+void synchronizeThreads
+(
+    const List<label>& sequence,
+    const PtrList<threadHandler<T> >& handler
+)
+{
+    forAll(sequence, i)
+    {
+        // Wait for a signal from this thread before moving on.
+        handler[sequence[i]].waitForSignal(threadHandler<T>::STOP);
+    }
+}
+
+
+// Execute threads for the submitted static function by sequence
+template <class T>
+void executeThreads
+(
+    const List<label>& sequence,
+    PtrList<threadHandler<T> >& handler,
+    void (*tFunction)(void*)
+)
+{
+    if (!handler.size())
+    {
+        FatalErrorIn
+        (
+            "\n\n"
+            "template <class T>\n"
+            "void executeThreads\n"
+            "(\n"
+            "    const List<label>& sequence,\n"
+            "    PtrList<threadHandler<T> >& handler,\n"
+            "    void (*tFunction)(void*)\n"
+            ")\n"
+        )
+            << "Empty handler list."
+            << abort(FatalError);
+    }
+
+    // Fetch threader reference
+    const multiThreader& threader = handler[0].threader();
+
+    // Lock slave threads by sequence
+    lockThreads(sequence, handler);
+
+    forAll(sequence, i)
+    {
+        // Submit jobs to the work queue
+        threader.addToWorkQueue(tFunction, &(handler[sequence[i]]));
+
+        // Wait for a signal from this thread before moving on.
+        handler[sequence[i]].waitForSignal(threadHandler<T>::START);
+    }
+
+    // Synchronize threads
+    synchronizeThreads(sequence, handler);
+}
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// ************************************************************************* //

src/OSspecific/MSWindows/printStack.C

@@ -0,0 +1,440 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "error.H"
+#include "IStringStream.H"
+#include "OStringStream.H"
+#include "OSspecific.H"
+#include "IFstream.H"
+#include "readHexLabel.H"
+
+#include <cxxabi.h>
+#include <dlfcn.h>
+#include <stdlib.h>
+#include <search.h>
+#include <stdio.h>
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+string pOpen(const string &cmd, label line=0)
+{
+    const int MAX = 1000;
+
+    FILE *cmdPipe = popen(cmd.c_str(), "r");
+
+    if (cmdPipe)
+    {
+        // Read line number of lines
+        for (label cnt = 0; cnt <= line; cnt++)
+        {
+            char buffer[MAX];
+
+            char* s = fgets(buffer, MAX-1, cmdPipe);
+
+            if (s == NULL)
+            {
+#ifdef darwin
+                // workaround for the Python-Script
+                for(int i=0;i<MAX;i++) {
+                    if(buffer[i]=='\n') {
+                        buffer[i]='\0';
+                    }
+                }
+                return buffer;
+#else
+                return "";
+#endif
+            }
+
+            if (cnt == line)
+            {
+                string str(buffer);
+                return str.substr(0, str.size()-1);
+            }
+        }
+        pclose(cmdPipe);
+    }
+
+    return "";
+}
+
+
+// use popen to call addr2line (using bfd.h directly would have
+// meant relinking everything)
+
+void printSourceFileAndLine
+(
+    Ostream& os,
+    const HashTable<label, fileName>& addressMap,
+    const fileName& filename,
+    const word& address
+)
+{
+    word myAddress = address;
+
+#ifndef darwin
+    if (filename.ext() == "so")
+#else
+    if (filename.ext() == "dylib")
+#endif
+    {
+        // Convert offset into .so into offset into executable.
+
+        void *addr;
+        sscanf(myAddress.c_str(), "%p",&addr);
+
+        //Dl_info info;
+
+        //dladdr(addr, &info);
+
+        unsigned long offset(0);// = reinterpret_cast<unsigned long>(info.dli_fbase);
+
+        IStringStream addressStr(address.substr(2));
+        label addressValue = readHexLabel(addressStr);
+        label relativeAddress = addressValue-offset;
+
+        // Reconstruct hex word from address
+        OStringStream nStream;
+        nStream << "0x" << hex << relativeAddress;
+        myAddress = nStream.str();
+    }
+
+    if (filename[0] == '/')
+    {
+        string line = pOpen
+        (
+#ifndef darwin
+            "addr2line -f --demangle=auto --exe "
+#else
+            //            "gaddr2line -f --inline --demangle=auto --exe "
+            "addr2line4Mac.py "
+#endif
+          + filename
+          + " "
+          + myAddress,
+            1
+        );
+
+        if (line == "")
+        {
+            os << " addr2line failed";
+        }
+        else if (line == "??:0")
+        {
+            os << " in " << filename;
+        }
+        else
+        {
+            string cwdLine(line.replaceAll(cwd() + '/', ""));
+
+            string homeLine(cwdLine.replaceAll(home(), '~'));
+
+            os << " at " << homeLine.c_str();
+        }
+    }
+}
+
+#ifdef darwin
+
+// Trying to emulate the original backtrace and backtrace_symbol from the glibc
+// After an idea published by Rush Manbert at http://lists.apple.com/archives/xcode-users/2006/Apr/msg00528.html
+
+template<int level>
+void *getStackAddress() 
+{
+    const unsigned int stackLevel=level;
+    return (
+        __builtin_frame_address(level) 
+        ? __builtin_return_address(stackLevel)
+        : (void *)0
+    );
+};
+
+#define GET_STACK_ADDRESS(lvl)              \
+    case lvl: {return getStackAddress<lvl>(); break; }
+
+// please don't laugh. For some reason this is necessary (the compiler won't accept it otherwise)
+void *getStackAddress(int level)
+{
+    switch(level) {
+        GET_STACK_ADDRESS(0);
+        GET_STACK_ADDRESS(1);
+        GET_STACK_ADDRESS(2);
+        GET_STACK_ADDRESS(3);
+        GET_STACK_ADDRESS(4);
+        GET_STACK_ADDRESS(5);
+        GET_STACK_ADDRESS(6);
+        GET_STACK_ADDRESS(7);
+        GET_STACK_ADDRESS(8);
+        GET_STACK_ADDRESS(9);
+        GET_STACK_ADDRESS(10);
+        GET_STACK_ADDRESS(11);
+        GET_STACK_ADDRESS(12);
+        GET_STACK_ADDRESS(13);
+        GET_STACK_ADDRESS(14);
+        GET_STACK_ADDRESS(15);
+        GET_STACK_ADDRESS(16);
+        GET_STACK_ADDRESS(17);
+        GET_STACK_ADDRESS(18);
+        GET_STACK_ADDRESS(19);
+        GET_STACK_ADDRESS(20);
+        GET_STACK_ADDRESS(21);
+        default:
+            return (void *)0;
+            break;
+    }
+}
+
+unsigned backtrace(void **bt, unsigned maxAddrs) 
+{
+    unsigned valid=0;
+    bool ok=true;
+
+    for(int level=0;level<maxAddrs;level++) {
+        if(ok) {
+            bt[level]=getStackAddress(level);
+            
+            if(bt[level]!=(void *)0) {
+                valid=level;
+            } else {
+                ok=false;
+            }
+        } else {
+            bt[level]=(void *)0;
+        }
+    }
+
+    return valid;
+}
+
+// This function is a potential memory leak. But I don't care because the program is terminating anyway
+char **backtrace_symbols(void **bt,unsigned nr) 
+{
+    char **strings=(char **)malloc(sizeof(char *)*nr);
+
+    for(unsigned i=0;i<nr;i++) {
+        Dl_info info;
+        int result=dladdr(bt[i],&info);
+
+        char tmp[1000];
+#ifdef darwinIntel64
+        sprintf(tmp,"%s(%s+%p) [%p]",info.dli_fname,info.dli_sname,(void *)((unsigned long)bt[i]-(unsigned long)info.dli_saddr),bt[i]);
+#else
+        sprintf(tmp,"%s(%s+%p) [%p]",info.dli_fname,info.dli_sname,(void *)((unsigned int)bt[i]-(unsigned int)info.dli_saddr),bt[i]);
+#endif
+        strings[i]=(char *)malloc(strlen(tmp)+1);
+        strcpy(strings[i],tmp);
+    }
+
+    return strings;
+}
+
+#endif
+
+void getSymbolForRaw
+(
+    Ostream& os,
+    const string& raw,
+    const fileName& filename,
+    const word& address
+)
+{
+    if (filename.size() && filename[0] == '/')
+    {
+        string fcnt = pOpen
+        (
+#ifndef darwin
+            "addr2line -f --demangle=auto --exe "
+#else
+            //            "gaddr2line -f --inline --demangle=auto --exe "
+            "addr2line4Mac.py "
+#endif
+          + filename
+          + " "
+          + address
+        );
+
+        if (fcnt != "")
+        {
+            os << fcnt.c_str();
+            return;
+        }
+    }
+    os << "Uninterpreted: " << raw.c_str();
+}
+
+void error::printStack(Ostream& os)
+{
+    // Do not print anything if FOAM_ABORT is not set
+    if (!env("FOAM_ABORT"))
+    {
+        return;
+    }
+
+    // Reads the starting addresses for the dynamically linked libraries
+    // from the /proc/pid/maps-file
+    // I'm afraid this works only for Linux 2.6-Kernels (may work on 2.4)
+    // Note2: the filenames in here will have softlinks resolved so will
+    // go wrong when having e.g. OpenFOAM installed under a softlink.
+
+    HashTable<label, fileName> addressMap;
+    {
+        IFstream is("/proc/" + name(pid()) + "/maps");
+
+        while(is.good())
+        {
+            string line;
+            is.getLine(line);
+
+            string::size_type space = line.rfind(' ') + 1;
+            fileName libPath = line.substr(space, line.size()-space);
+
+            if (libPath.size() && libPath[0] == '/')
+            {
+                string offsetString(line.substr(0, line.find('-')));
+                IStringStream offsetStr(offsetString);
+                addressMap.insert(libPath, readHexLabel(offsetStr));
+            }
+        }
+    }
+
+    // Get raw stack symbols
+    void *array[100] = {0};
+    size_t size = 0; //backtrace(array, 100);
+    char **strings = 0; //backtrace_symbols(array, size);
+
+    // See if they contain function between () e.g. "(__libc_start_main+0xd0)"
+    // and see if cplus_demangle can make sense of part before +
+    // HJ, formatting of stack backtrace.  17/Dec/2008
+    os << nl;
+    for (size_t i = 0; i < size; i++)
+    {
+        string msg(strings[i]);
+        fileName programFile;
+        word address;
+
+        os << '#' << label(i) << "  ";
+        //os << "Raw   : " << msg << "\n\t";
+        {
+            string::size_type lPos = msg.find('[');
+            string::size_type rPos = msg.find(']');
+
+            if (lPos != string::npos && rPos != string::npos && lPos<rPos)
+            {
+                address = msg.substr(lPos+1, rPos-lPos-1);
+                msg = msg.substr(0, lPos);
+            }
+
+            string::size_type bracketPos = msg.find('(');
+            string::size_type spacePos = msg.find(' ');
+            if (bracketPos != string::npos || spacePos != string::npos)
+            {
+                programFile = msg.substr(0, min(spacePos, bracketPos));
+
+                // not an absolute path
+                if (programFile[0] != '/')
+                {
+                    string tmp = pOpen("which " + programFile);
+                    if (tmp[0] == '/' || tmp[0] == '~')
+                    {
+                        programFile = tmp;
+                    }
+                }
+            }
+        }
+
+        string::size_type bracketPos = msg.find('(');
+
+        if (bracketPos != string::npos)
+        {
+            string::size_type start = bracketPos+1;
+
+            string::size_type plusPos = msg.find('+', start);
+
+            if (plusPos != string::npos)
+            {
+                string cName(msg.substr(start, plusPos-start));
+
+                int status;
+                char* cplusNamePtr = abi::__cxa_demangle
+                (
+                    cName.c_str(),
+                    NULL,                   // have it malloc itself
+                    0,
+                    &status
+                );
+
+                if (status == 0 && cplusNamePtr)
+                {
+                    os << cplusNamePtr;
+                    free(cplusNamePtr);
+                }
+                else
+                {
+                    os << cName.c_str();
+                }
+            }
+            else
+            {
+                string::size_type endBracketPos = msg.find(')', start);
+
+                if (endBracketPos != string::npos)
+                {
+                    string fullName(msg.substr(start, endBracketPos-start));
+
+                    os << fullName.c_str() << nl;
+                }
+                else
+                {
+                    // Print raw message
+                    getSymbolForRaw(os, msg, programFile, address);
+                }
+            }
+        }
+        else
+        {
+            // Print raw message
+            getSymbolForRaw(os, msg, programFile, address);
+        }
+
+        printSourceFileAndLine(os, addressMap, programFile, address);
+
+        os << nl;
+    }
+
+    free(strings);
+}
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// ************************************************************************* //

src/OSspecific/MSWindows/regExp.C

@@ -0,0 +1,202 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "regExp.H"
+#include "label.H"
+#include "string.H"
+#include "List.H"
+#include "IOstreams.H"
+
+// Alternative regular expression libraries to consider are:
+// Boost http://www.boost.org/libs/regex/doc/
+// GRETA http://research.microsoft.com/projects/greta/
+// Henry Spencer's http://arglist.com/regex/
+// 
+// Chose DEELX http://www.regexlab.com/en/deelx/
+// for its ease of integration - one header file
+#include "deelx.h"
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::regExp::regExp()
+:
+    preg_(0)
+{}
+
+
+Foam::regExp::regExp(const char* pattern, const bool ignoreCase)
+:
+    preg_(0)
+{
+    set(pattern, ignoreCase);
+}
+
+
+Foam::regExp::regExp(const std::string& pattern, const bool ignoreCase)
+:
+    preg_(0)
+{
+    set(pattern.c_str(), ignoreCase);
+}
+
+
+// * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
+
+Foam::regExp::~regExp()
+{
+    clear();
+}
+
+
+// * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * * //
+
+void Foam::regExp::set(const char* pattern, const bool ignoreCase) const
+{
+    clear();
+
+    // avoid NULL pointer and zero-length patterns
+    if (pattern && *pattern)
+    {
+        int cflags = EXTENDED;
+        if (ignoreCase)
+        {
+            cflags |= IGNORECASE;
+        }
+
+        preg_ = new CRegexpT<char>(pattern, cflags);
+    }
+}
+
+
+void Foam::regExp::set(const std::string& pattern, const bool ignoreCase) const
+{
+    return set(pattern.c_str(), ignoreCase);
+}
+
+
+bool Foam::regExp::clear() const
+{
+    if (preg_)
+    {
+        delete preg_;
+        preg_ = 0;
+
+        return true;
+    }
+
+    return false;
+}
+
+
+std::string::size_type Foam::regExp::find(const std::string& str) const
+{
+    std::string::size_type pos = std::string::npos;
+
+    if (preg_ && !str.empty())
+    {
+        const MatchResult result = preg_->Match(str.c_str());
+
+        if( 0 < result.IsMatched() )
+        {
+            pos = result.GetStart();
+        }
+    }
+
+    return pos;
+}
+
+
+bool Foam::regExp::match(const std::string& str) const
+{
+    bool isExactMatch = false;
+
+
+    if( preg_ && !str.empty() )
+    {
+        const MatchResult result = preg_->MatchExact(str.c_str());
+        isExactMatch = (0 < result.IsMatched());
+    }
+
+    return isExactMatch;
+}
+
+
+bool Foam::regExp::match(const string& str, List<string>& groups) const
+{
+    bool isMatch = false;
+
+    if( preg_ && !str.empty() )
+    {
+        const MatchResult results = preg_->MatchExact(str.c_str());
+        isMatch = (0 < results.IsMatched());
+
+        if( isMatch ) 
+        {
+            int const notFound = -1;
+            int start, end;
+            const int groupsCount = results.MaxGroupNumber();
+            groups.setSize(groupsCount);
+        
+            for (int i = 0; groupsCount > i; ++i)
+            {
+                start = results.GetGroupStart(i);
+                end   = results.GetGroupEnd(i);
+                  
+                if ((notFound < start) && (notFound < end))
+                {
+                    groups[i] = str.substr(start, end - start);
+                }
+                else
+                {
+                    groups[i].clear();
+                }
+            }
+        }
+    }
+
+    if( !isMatch )
+    {
+        groups.clear();
+    }
+
+    return isMatch;
+}
+
+
+// * * * * * * * * * * * * * * Member Operators  * * * * * * * * * * * * * * //
+
+void Foam::regExp::operator=(const char* pat)
+{
+    set(pat);
+}
+
+
+void Foam::regExp::operator=(const std::string& pat)
+{
+    set(pat);
+}
+
+
+// ************************************************************************* //

src/OSspecific/MSWindows/regExp.H

@@ -0,0 +1,185 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::regExp
+
+Description
+    Wrapper around POSIX extended regular expressions.
+
+SeeAlso
+    The manpage regex(7) for more information about POSIX regular expressions.
+    These differ somewhat from @c Perl and @c sed regular expressions.
+
+SourceFiles
+    regExp.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef regExp_H
+#define regExp_H
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#include <string>
+
+template <class T> class CRegexpT;
+
+namespace Foam
+{
+
+// Forward declaration of classes
+class string;
+template<class T> class List;
+
+/*---------------------------------------------------------------------------*\
+                           Class regExp Declaration
+\*---------------------------------------------------------------------------*/
+
+class regExp
+{
+    // Private data
+
+        //- Precompiled regular expression
+        mutable CRegexpT<char>* preg_;
+
+    // Private member functions
+
+        //- Disallow default bitwise copy construct
+        regExp(const regExp&);
+
+        //- Disallow default bitwise assignment
+        void operator=(const regExp&);
+
+public:
+
+        //- Is character a regular expression meta-character?
+        //  any character: '.' \n
+        //  quantifiers: '*', '+', '?' \n
+        //  grouping: '(', '|', ')' \n
+        //  range: '[', ']' \n
+        //
+        //  Don't bother checking for '{digit}' bounds
+        inline static bool meta(char c)
+        {
+            return
+            (
+                (c == '.')                           // any character
+             || (c == '*' || c == '+' || c == '?')   // quantifiers
+             || (c == '(' || c == ')' || c == '|')   // grouping/branching
+             || (c == '[' || c == ']')               // range
+            );
+        }
+
+
+    // Constructors
+
+        //- Construct null
+        regExp();
+
+        //- Construct from character array, optionally ignoring case
+        regExp(const char*, const bool ignoreCase=false);
+
+        //- Construct from std::string (or string), optionally ignoring case
+        regExp(const std::string&, const bool ignoreCase=false);
+
+    // Destructor
+
+        ~regExp();
+
+
+    // Member functions
+
+    //- Access
+
+        //- Return true if a precompiled expression does not exist
+        inline bool empty() const
+        {
+            return !preg_;
+        }
+
+        //- Does a precompiled expression exist?
+        inline bool exists() const
+        {
+            return preg_ ? true : false;
+        }
+
+
+    //- Editing
+
+        //- Compile pattern into a regular expression, optionally ignoring case
+        void set(const char*, const bool ignoreCase=false) const;
+
+        //- Compile pattern into a regular expression, optionally ignoring case
+        void set(const std::string&, const bool ignoreCase=false) const;
+
+
+        //- Release precompiled expression.
+        //  Returns true if precompiled expression existed before clear
+        bool clear() const;
+
+
+    //- Searching
+
+        //- Find position within string.
+        //  Returns the index where it begins or string::npos if not found
+        std::string::size_type find(const std::string& str) const;
+
+        //- Return true if it matches the entire string
+        //  The begin-of-line (^) and end-of-line ($) anchors are implicit
+        bool match(const std::string&) const;
+
+        //- Return true if it matches and sets the sub-groups matched
+        //  The begin-of-line (^) and end-of-line ($) anchors are implicit
+        bool match(const string&, List<string>& groups) const;
+
+        //- Return true if the regex was found in within string
+        bool search(const std::string& str) const
+        {
+            return std::string::npos != find(str);
+        }
+
+
+    // Member Operators
+
+        //- Assign and compile pattern from a character array
+        //  Always case sensitive
+        void operator=(const char*);
+
+        //- Assign and compile pattern from string
+        //  Always case sensitive
+        void operator=(const std::string&);
+
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

src/OSspecific/MSWindows/signals/sigFpe.C

@@ -0,0 +1,169 @@
+/*---------------------------------------------------------------------------*\
+    Copyright            : (C) 2011 Symscape
+    Website              : www.symscape.com
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    sigFpe
+
+\*---------------------------------------------------------------------------*/
+
+#include "error.H"
+#include "sigFpe.H"
+
+#include "JobInfo.H"
+#include "OSspecific.H"
+#include "IOstreams.H"
+
+#include <float.h>
+
+
+// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
+
+__p_sig_fn_t Foam::sigFpe::oldAction_ = SIG_DFL;
+
+static unsigned int fpOld_ = 0;
+
+
+static void clearFpe()
+{
+    //_clearfp();
+    //_controlfp(fpOld_, 0xFFFFFFFF);
+}
+
+
+void Foam::sigFpe::sigFpeHandler(int)
+{
+    const __p_sig_fn_t success = ::signal(SIGFPE, oldAction_);
+
+    // Reset old handling
+    if( SIG_ERR == success )
+    {
+        FatalErrorIn
+        (
+            "Foam::sigSegv::sigFpeHandler()"
+        )   << "Cannot reset SIGFPE trapping"
+            << abort(FatalError);    
+    }
+
+    // Update jobInfo file
+    jobInfo.signalEnd();
+
+    error::printStack(Perr);
+
+    clearFpe();
+
+    // Throw signal (to old handler)
+    ::raise(SIGFPE);
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::sigFpe::sigFpe()
+{
+    oldAction_ = SIG_DFL;
+}
+
+
+// * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
+
+Foam::sigFpe::~sigFpe()
+{
+    if( env("FOAM_SIGFPE") )
+    {
+        clearFpe();
+
+        // Reset signal
+        const __p_sig_fn_t success = ::signal(SIGFPE, oldAction_);
+        oldAction_ = SIG_DFL;
+
+        if( SIG_ERR == success )
+        {
+            FatalErrorIn
+            (
+                "Foam::sigFpe::~sigFpe()"
+            )   << "Cannot reset SIGFPE trapping"
+                << abort(FatalError);    
+        }
+    }
+
+    if( env("FOAM_SETNAN") )
+    {
+        WarningIn("Foam::sigFpe::~sigFpe()")
+            << "FOAM_SETNAN not supported under MSwindows "
+            << endl;
+    }
+}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+void Foam::sigFpe::set(const bool verbose)
+{
+    if( SIG_DFL != oldAction_ )
+    {
+        FatalErrorIn
+        (
+            "Foam::sigFpe::set()"
+        )   << "Cannot call sigFpe::set() more than once"
+            << abort(FatalError);
+    }
+
+    if( env("FOAM_SIGFPE") )
+    {
+        if( verbose )
+        {
+            Info<< "SigFpe : Enabling floating point exception trapping"
+                << " (FOAM_SIGFPE)." << endl;
+        }
+/*
+        fpOld_ = _controlfp(0, 0);
+        const unsigned int fpNew = 
+          fpOld_ & ~(_EM_ZERODIVIDE | _EM_INVALID | _EM_OVERFLOW);
+        _controlfp(fpNew, _MCW_EM);
+
+        oldAction_ = ::signal(SIGFPE, &Foam::sigFpe::sigFpeHandler);        
+
+        if( SIG_ERR == oldAction_ )
+        {
+            oldAction_ = SIG_DFL;
+
+            FatalErrorIn
+            (
+                "Foam::sigFpe::set()"
+            )   << "Cannot set SIGFPE trapping"
+                << abort(FatalError);    
+        }
+*/
+    }
+
+
+    if( env("FOAM_SETNAN") )
+    {
+        if( verbose )
+        {
+            WarningIn("Foam::sigFpe::set()")
+              << "FOAM_SETNAN not supported under MSwindows "
+              << endl;
+        }
+    }
+}
+
+
+// ************************************************************************* //

src/OSspecific/MSWindows/signals/sigFpe.H

@@ -0,0 +1,99 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright held by original author
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software; you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation; either version 2 of the License, or (at your
+    option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM; if not, write to the Free Software Foundation,
+    Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
+
+Class
+    Foam::sigFpe
+
+Description
+    Set up trapping for floating point exceptions (signal FPE).
+
+    Controlled by two env vars:
+    @param FOAM_SIGFPE \n
+        exception trapping
+    @param FOAM_SETNAN \n
+        initialization of all malloced memory to NaN. If FOAM_SIGFPE
+        also set, this will cause usage of uninitialized scalars to trigger
+        an abort.
+
+SourceFiles
+    sigFpe.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef sigFpe_H
+#define sigFpe_H
+
+#include "OSspecific.H"
+#include <signal.h>
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                           Class sigFpe Declaration
+\*---------------------------------------------------------------------------*/
+
+class sigFpe
+{
+    // Private data
+
+        //- Saved old signal trapping setting
+        static __p_sig_fn_t oldAction_;
+
+
+    // Static data members
+
+        //- Handler for caught signals
+        static void sigFpeHandler(int);
+
+public:
+
+
+    // Constructors
+
+        sigFpe();
+
+
+    // Destructor
+
+        ~sigFpe();
+
+
+    // Member functions
+
+        void set(const bool verbose);
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

src/OSspecific/MSWindows/signals/sigInt.C

@@ -0,0 +1,115 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright held by original author
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software; you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation; either version 2 of the License, or (at your
+    option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM; if not, write to the Free Software Foundation,
+    Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
+
+\*---------------------------------------------------------------------------*/
+
+#include "error.H"
+#include "sigInt.H"
+#include "JobInfo.H"
+#include "IOstreams.H"
+
+// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
+
+__p_sig_fn_t Foam::sigInt::oldAction_ = SIG_DFL;
+
+// * * * * * * * * * * * * * Private Member Functions  * * * * * * * * * * * //
+
+void Foam::sigInt::sigIntHandler(int)
+{
+    // Reset old handling
+    const __p_sig_fn_t success = ::signal(SIGINT, oldAction_);
+
+    if( SIG_ERR == success )
+    {
+        FatalErrorIn
+        (
+            "Foam::sigInt::sigIntHandler()"
+        )   << "Cannot reset SIGINT trapping"
+            << abort(FatalError);
+    }
+
+    // Update jobInfo file
+    jobInfo.signalEnd();
+
+    // Throw signal (to old handler)
+    raise(SIGINT);
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::sigInt::sigInt()
+{
+    oldAction_ = SIG_DFL;
+}
+
+
+// * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
+
+Foam::sigInt::~sigInt()
+{
+    // Reset old handling
+    const __p_sig_fn_t success = ::signal(SIGINT, oldAction_);
+    oldAction_ = SIG_DFL;
+
+    if( SIG_ERR == success )
+    {
+        FatalErrorIn
+        (
+            "Foam::sigInt::~sigInt()"
+        )   << "Cannot reset SIGINT trapping"
+            << abort(FatalError);
+    }
+}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+void Foam::sigInt::set(const bool verbose)
+{
+    if( SIG_DFL != oldAction_ )
+    {
+        FatalErrorIn
+        (
+            "Foam::sigInt::set()"
+        )   << "Cannot call sigInt::set() more than once"
+            << abort(FatalError);
+    }
+
+    oldAction_ = ::signal(SIGINT, &Foam::sigInt::sigIntHandler);
+
+    if( SIG_ERR == oldAction_ )
+    {
+        oldAction_ = SIG_DFL;
+
+        FatalErrorIn
+        (
+            "Foam::sigInt::set()"
+        )   << "Cannot set SIGINT trapping"
+            << abort(FatalError);
+    }
+}
+
+
+// ************************************************************************* //

src/OSspecific/MSWindows/signals/sigInt.H

@@ -0,0 +1,96 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright held by original author
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software; you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation; either version 2 of the License, or (at your
+    option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM; if not, write to the Free Software Foundation,
+    Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
+
+Class
+    Foam::sigInt
+
+Description
+    Signal handler for INT interupt.
+
+    The standard interupt handler is overridden to ensure that the
+    runningJob file is removed.
+
+See Also
+    Foam::JobInfo
+
+SourceFiles
+    sigInt.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef sigInt_H
+#define sigInt_H
+
+#include "OSspecific.H"
+#include <signal.h>
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                           Class sigInt Declaration
+\*---------------------------------------------------------------------------*/
+
+class sigInt
+{
+    // Private data
+
+        //- Saved old signal trapping setting
+        static __p_sig_fn_t oldAction_;
+
+
+    // Private Member Functions
+
+        static void sigIntHandler(int);
+
+
+public:
+
+    // Constructors
+
+        sigInt();
+
+
+    // Destructor
+
+        ~sigInt();
+
+
+    // Member functions
+
+        void set(const bool verbose);
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

src/OSspecific/MSWindows/signals/sigQuit.C

@@ -0,0 +1,118 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright held by original author
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software; you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation; either version 2 of the License, or (at your
+    option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM; if not, write to the Free Software Foundation,
+    Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
+
+\*---------------------------------------------------------------------------*/
+
+#include "error.H"
+#include "sigQuit.H"
+#include "JobInfo.H"
+#include "IOstreams.H"
+
+// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
+
+__p_sig_fn_t Foam::sigQuit::oldAction_ = SIG_DFL;
+
+// * * * * * * * * * * * * * Private Member Functions  * * * * * * * * * * * //
+
+void Foam::sigQuit::sigQuitHandler(int)
+{
+    // Reset old handling
+    const __p_sig_fn_t success = ::signal(SIGBREAK, oldAction_);
+
+    if( SIG_ERR == success )
+    {
+        FatalErrorIn
+        (
+            "Foam::sigQuit::sigQuitHandler()"
+        )   << "Cannot reset SIGQUIT trapping"
+            << abort(FatalError);    
+    }
+
+    // Update jobInfo file
+    jobInfo.signalEnd();
+
+    error::printStack(Perr);
+
+    // Throw signal (to old handler)
+    ::raise(SIGBREAK);
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::sigQuit::sigQuit()
+{
+    oldAction_ = SIG_DFL;
+}
+
+
+// * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
+
+Foam::sigQuit::~sigQuit()
+{
+    // Reset old handling
+    if( SIG_DFL != oldAction_ )
+    {
+        const __p_sig_fn_t success = ::signal(SIGBREAK, oldAction_);
+        oldAction_ = SIG_DFL;
+
+        if( SIG_ERR == success )
+        {
+            FatalErrorIn("Foam::sigQuit::~sigQuit()")
+                << "Cannot reset SIGBREAK trapping"
+                << abort(FatalError);    
+        }
+    }
+}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+void Foam::sigQuit::set(const bool verbose)
+{
+    if( SIG_DFL != oldAction_ )
+    {
+        FatalErrorIn
+        (
+            "Foam::sigQuit::set()"
+        )   << "Cannot call sigQuit::set() more than once"
+            << abort(FatalError);
+    }
+
+    oldAction_ = ::signal(SIGBREAK, &Foam::sigQuit::sigQuitHandler);        
+
+    if( SIG_ERR == oldAction_ )
+    {
+		oldAction_ = SIG_DFL;
+
+        FatalErrorIn
+        (
+            "Foam::sigQuit::set()"
+        )   << "Cannot set SIGQUIT trapping"
+            << abort(FatalError);    
+    }
+}
+
+
+// ************************************************************************* //

src/OSspecific/MSWindows/signals/sigQuit.H

@@ -0,0 +1,96 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright held by original author
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software; you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation; either version 2 of the License, or (at your
+    option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM; if not, write to the Free Software Foundation,
+    Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
+
+Class
+    Foam::sigQuit
+
+Description
+    Signal handler for QUIT interupt.
+
+    The standard interupt handler is overridden to ensure that the
+    runningJob file is removed.
+
+See Also
+    Foam::JobInfo
+
+SourceFiles
+    sigQuit.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef sigQuit_H
+#define sigQuit_H
+
+#include "OSspecific.H"
+#include <signal.h>
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                           Class sigQuit Declaration
+\*---------------------------------------------------------------------------*/
+
+class sigQuit
+{
+    // Private data
+
+        //- Saved old signal trapping setting
+        static __p_sig_fn_t oldAction_;
+
+
+    // Private Member Functions
+
+        static void sigQuitHandler(int);
+
+
+public:
+
+    // Constructors
+
+        sigQuit();
+
+
+    // Destructor
+
+        ~sigQuit();
+
+
+    // Member functions
+
+        void set(const bool verbose);
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

src/OSspecific/MSWindows/signals/sigSegv.C

@@ -0,0 +1,117 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright held by original author
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software; you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation; either version 2 of the License, or (at your
+    option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM; if not, write to the Free Software Foundation,
+    Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
+
+\*---------------------------------------------------------------------------*/
+
+#include "error.H"
+#include "sigSegv.H"
+#include "JobInfo.H"
+#include "IOstreams.H"
+
+// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
+
+__p_sig_fn_t Foam::sigSegv::oldAction_ = SIG_DFL;
+
+// * * * * * * * * * * * * * Private Member Functions  * * * * * * * * * * * //
+
+void Foam::sigSegv::sigSegvHandler(int)
+{
+    // Reset old handling
+    const __p_sig_fn_t success = ::signal(SIGSEGV, oldAction_);
+
+    if( SIG_ERR == success )
+    {
+        FatalErrorIn
+        (
+            "Foam::sigSegv::sigSegvHandler()"
+        )   << "Cannot reset SIGSEGV trapping"
+            << abort(FatalError);    
+    }
+
+    // Update jobInfo file
+    jobInfo.signalEnd();
+
+    error::printStack(Perr);
+
+    // Throw signal (to old handler)
+    ::raise(SIGSEGV);
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::sigSegv::sigSegv()
+{
+    oldAction_ = SIG_DFL;
+}
+
+
+// * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
+
+Foam::sigSegv::~sigSegv()
+{
+    // Reset old handling
+    const __p_sig_fn_t success = ::signal(SIGSEGV, oldAction_);
+    oldAction_ = SIG_DFL;
+
+    if( SIG_ERR == success )
+    {
+        FatalErrorIn
+        (
+            "Foam::sigSegv::~sigSegv()"
+        )   << "Cannot reset SIGSEGV trapping"
+            << abort(FatalError);    
+    }
+}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+void Foam::sigSegv::set(const bool verbose)
+{
+    if( SIG_DFL != oldAction_ )
+    {
+        FatalErrorIn
+        (
+            "Foam::sigSegv::set()"
+        )   << "Cannot call sigSegv::set() more than once"
+            << abort(FatalError);
+    }
+
+    oldAction_ = ::signal(SIGSEGV, &Foam::sigSegv::sigSegvHandler);        
+
+    if( SIG_ERR == oldAction_ )
+    {
+        oldAction_ = SIG_DFL;
+
+        FatalErrorIn
+        (
+            "Foam::sigSegv::set()"
+        )   << "Cannot set SIGSEGV trapping"
+            << abort(FatalError);    
+    }
+}
+
+
+// ************************************************************************* //

src/OSspecific/MSWindows/signals/sigSegv.H

@@ -0,0 +1,96 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright held by original author
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software; you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation; either version 2 of the License, or (at your
+    option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM; if not, write to the Free Software Foundation,
+    Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
+
+Class
+    Foam::sigSegv
+
+Description
+    Signal handler for SEGV interupt.
+
+    The standard interupt handler is overridden to ensure that the
+    runningJob file is removed.
+
+See Also
+    Foam::JobInfo
+
+SourceFiles
+    sigSegv.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef sigSegv_H
+#define sigSegv_H
+
+#include "OSspecific.H"
+#include <signal.h>
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                           Class sigSegv Declaration
+\*---------------------------------------------------------------------------*/
+
+class sigSegv
+{
+    // Private data
+
+        //- Saved old signal trapping setting
+        static __p_sig_fn_t oldAction_;
+
+
+    // Private Member Functions
+
+        static void sigSegvHandler(int);
+
+
+public:
+
+    // Constructors
+
+        sigSegv();
+
+
+    // Destructor
+
+        ~sigSegv();
+
+
+    // Member functions
+
+        void set(const bool verbose);
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

src/OSspecific/MSWindows/timer.C

@@ -0,0 +1,175 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+Description
+
+\*---------------------------------------------------------------------------*/
+
+#include "scalar.H"
+#include "MSwindows.H"
+
+#define WINVER 0x0500 // To access CreateTimerQueueTimer
+#include <windows.h>
+
+#define SIGALRM 14
+
+#include "error.H"
+#include "timer.H"
+
+// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
+
+defineTypeNameAndDebug(Foam::timer, 0);
+
+jmp_buf Foam::timer::envAlarm;
+
+__p_sig_fn_t Foam::timer::oldAction_ = SIG_DFL;
+
+static HANDLE hTimer_ = NULL;
+
+// * * * * * * * * * * * * * Static Member Functions * * * * * * * * * * * * //
+
+void Foam::timer::signalHandler(int)
+{
+    if (debug)
+    {
+        Info<< "Foam::timer::signalHandler(int sig) : "
+            << " timed out. Jumping."
+            << endl;
+    }
+    longjmp(envAlarm, 1);
+}
+
+
+static VOID CALLBACK timerExpired(PVOID lpParam, BOOLEAN TimerOrWaitFired)
+{
+    ::raise(SIGALRM);
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+
+// Construct from components
+Foam::timer::timer(const unsigned int newTimeOut)
+:
+    newTimeOut_(newTimeOut)
+{
+
+    if (newTimeOut > 0)
+    {
+        // Is singleton since handler is static function
+        if( NULL != hTimer_ )
+        {
+            FatalErrorIn
+            (
+                "Foam::timer::timer(const unsigned int)"
+            )   << "timer already used."
+                << abort(FatalError);
+        }
+
+        // Install alarm signal handler:
+        oldAction_ = ::signal(SIGALRM, &Foam::timer::signalHandler);
+
+        if( SIG_ERR == oldAction_ )
+        {
+            oldAction_ = SIG_DFL;
+
+            FatalErrorIn
+            (
+                "Foam::timer::timer(const unsigned int)"
+            )   << "sigaction(SIGALRM) error"
+                << abort(FatalError);
+        }
+
+        if (debug)
+        {
+            Info<< "Foam::timer::timer(const unsigned int) : "
+                << " installing timeout " << int(newTimeOut_)
+                << " seconds." << endl;
+        }
+
+        const bool success = 
+          ::CreateTimerQueueTimer(&hTimer_, 
+                                  NULL, 
+                                  (WAITORTIMERCALLBACK)timerExpired,
+                                  NULL , 
+                                  newTimeOut * 1000, 
+                                  0, 0);
+
+        if (!success) 
+        {
+            hTimer_ = NULL;
+            FatalErrorIn
+            (
+                "Foam::timer::timer(const unsigned int)"
+            )   << "CreateTimerQueueTimer, "
+                << MSwindows::getLastError()
+                << abort(FatalError);    
+        }
+    }
+}
+
+
+// * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
+
+Foam::timer::~timer()
+{
+    if (newTimeOut_ > 0)
+    {
+        // Reset timer
+        const bool timerSuccess = 
+          ::DeleteTimerQueueTimer(NULL, hTimer_, NULL);
+        hTimer_ = NULL;
+
+        if (!timerSuccess) 
+        {
+            FatalErrorIn
+            (
+                "Foam::timer::~timer() "
+            )   << "DeleteTimerQueueTimer, "
+                << MSwindows::getLastError()
+                << abort(FatalError);    
+        }
+
+        if (debug)
+        {
+            Info<< "Foam::timer::~timer() timeOut="
+                << int(newTimeOut_) << endl;
+        }
+
+        const __p_sig_fn_t signalSuccess = signal(SIGALRM, oldAction_);
+        oldAction_ = SIG_DFL;
+
+        // Restore signal handler
+        if (SIG_ERR == signalSuccess)
+        {
+            FatalErrorIn
+            (
+                "Foam::timer::~timer()"
+            )   << "sigaction(SIGALRM) error"
+                << abort(FatalError);
+        }
+    }
+}
+
+// ************************************************************************* //

src/OSspecific/MSWindows/timer.H

@@ -0,0 +1,134 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | foam-extend: Open Source CFD
+   \\    /   O peration     | Version:     3.2
+    \\  /    A nd           | Web:         http://www.foam-extend.org
+     \\/     M anipulation  | For copyright notice see file Copyright
+-------------------------------------------------------------------------------
+License
+    This file is part of foam-extend.
+
+    foam-extend is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by the
+    Free Software Foundation, either version 3 of the License, or (at your
+    option) any later version.
+
+    foam-extend is distributed in the hope that it will be useful, but
+    WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+    General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with foam-extend.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::timer
+
+Description
+    Implements a timeout mechanism via sigalarm.
+
+    Example usage:
+    @code
+        timer myTimer(5);     // 5 sec
+        ..
+        if (timedOut(myTimer))
+        {
+            // timed out
+        }
+        else
+        {
+            // do something possible blocking
+        }
+    @endcode
+
+    Constructor set signal handler on sigalarm and alarm(). Destructor
+    clears these.
+
+    timedOut is macro because setjmp can't be in member function of timer.
+    ?something to do with stack frames.
+
+Warning
+    The setjmp restores complete register state so including local vars
+    held in regs. So if in blocking part something gets calced in a stack
+    based variable make sure it is declared 'volatile'.
+
+SourceFiles
+    timer.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef timer_H
+#define timer_H
+
+#include "className.H"
+
+#include <signal.h>
+#include <setjmp.h>
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+//- check it a timeout has occured
+//  keep setjmp in same stack frame so no function calls
+#define timedOut(x) \
+    (((x).newTimeOut_ > 0) ? setjmp(Foam::timer::envAlarm) : false)
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                           Class timer Declaration
+\*---------------------------------------------------------------------------*/
+
+class timer
+{
+    // Private data
+
+        //- old signal
+        static __p_sig_fn_t oldAction_;
+
+        //- old alarm() value
+        static unsigned int oldTimeOut_;
+
+
+    // Private Member Functions
+
+        //- alarm handler
+        static void signalHandler(int);
+
+
+public:
+
+    // Public data
+
+        //- Declare name of the class and its debug switch
+        ClassName("timer");
+
+        //- current time out value. Needed by macro timedOut
+        unsigned int newTimeOut_;
+
+        //- state for setjmp. Needed by macro timedOut
+        static jmp_buf envAlarm;
+
+
+    // Constructors
+
+        //- Construct from components.
+        //  newTimeOut=0 makes it do nothing.
+        timer(const unsigned int newTimeOut);
+
+
+    // Destructor
+
+        ~timer();
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

src/dbns/Make/options

@@ -1,3 +1,15 @@
+ifeq ($(WM_ARCH_BASE), mingw)
+EXE_INC = -g \
+    -I$(LIB_SRC)/finiteVolume/lnInclude \
+    -I$(LIB_SRC)/meshTools/lnInclude \
+    -I$(LIB_SRC)/thermophysicalModels/basic/lnInclude \
+    -I$(LIB_SRC)/turbulenceModels/compressible/turbulenceModel \
+    -I$(PARMGRIDGEN_INCLUDE_DIR)
+
+LIB_LIBS = \
+    -lfiniteVolume \
+    -L$(PARMGRIDGEN_LIB_DIR) -lIMlib -lmgrid
+else
 EXE_INC = -g \
     -I$(LIB_SRC)/finiteVolume/lnInclude \
     -I$(LIB_SRC)/meshTools/lnInclude \
@@ -9,3 +21,4 @@ EXE_INC = -g \
 LIB_LIBS = \
     -lfiniteVolume \
     -L$(PARMGRIDGEN_LIB_DIR) -lIMlib -lMGridGen
+endif

src/decompositionMethods/Allwmake

@@ -4,10 +4,10 @@ set -x
 
 wmakeLnInclude decompositionMethods
 
-wmake libso scotchDecomp
+wmake libso decompositionMethods
 wmake libso metisDecomp
 wmake libso parMetisDecomp
+wmake libso scotchDecomp
 
-wmake libso decompositionMethods
 
 # ----------------------------------------------------------------- end-of-file

src/decompositionMethods/metisDecomp/Make/options

@@ -4,5 +4,6 @@ EXE_INC = \
     -I../scotchDecomp/lnInclude
 
 LIB_LIBS = \
+    -ldecompositionMethods \
     -L$(FOAM_LIBBIN)/dummy \
     -L$(METIS_LIB_DIR) -lmetis

src/decompositionMethods/parMetisDecomp/Make/options

@@ -9,4 +9,8 @@ EXE_INC = \
 
 LIB_LIBS = \
     -L$(FOAM_MPI_LIBBIN) \
-    -L$(PARMETIS_LIB_DIR) -lparmetis
+    -L$(METIS_LIB_DIR) -lmetis \
+    -L$(PARMETIS_LIB_DIR) -lmetis -lparmetis \
+    -ldecompositionMethods \
+    -lmetisDecomp \
+    -L$(OPENMPI_DIR)/lib -lmpi

src/decompositionMethods/scotchDecomp/Make/options

@@ -8,6 +8,13 @@ LIB_LIBS = \
     -lfoam \
     -L$(SCOTCH_LIB_DIR) -lscotch \
     -L$(SCOTCH_LIB_DIR) -lscotcherrexit
+else ifeq ($(WM_ARCH_BASE), mingw)
+/* No librt for MinGW */
+LIB_LIBS = \
+    -ldecompositionMethods \
+    -L$(SCOTCH_LIB_DIR) -lscotch \
+    -L$(SCOTCH_LIB_DIR) -lscotcherrexit \
+    -L$(OPENMPI_DIR)/lib -lmpi
 else
 LIB_LIBS = \
     -L$(SCOTCH_LIB_DIR) -lscotch \

src/dynamicMesh/dynamicFvMesh/dynamicTopoFvMesh/Make/options

@@ -7,6 +7,7 @@ EXE_INC = \
     -I$(LIB_SRC)/finiteVolume/lnInclude \
 
 LIB_LIBS = \
+    -lpthread \
     -ldynamicMesh \
     -ldynamicFvMesh \
     -ldecompositionMethods \

src/finiteVolume/finiteVolume/divSchemes/gaussDivScheme/vectorGaussDivScheme.H

@@ -50,13 +50,13 @@ namespace fv
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
-template<>
+template<> inline
 tmp<BlockLduSystem<vector, scalar> > gaussDivScheme<vector>::fvmUDiv
 (
     const GeometricField<vector, fvPatchField, volMesh>&
 ) const;
 
-template<>
+template<> inline
 tmp<BlockLduSystem<vector, scalar> > gaussDivScheme<vector>::fvmUDiv
 (
     const surfaceScalarField& flux,

src/foam/Make/options

@@ -3,9 +3,19 @@ include $(RULES)/mplib$(WM_MPLIB)
 EXE_INC = $(PFLAGS) $(PINC)\
     -I$(WM_THIRD_PARTY_DIR)/zlib-1.2.3
 
+ifeq ($(WM_ARCH_BASE), mingw)
+LIB_LIBS = $(PLIBS)\
+    $(FOAM_LIBBIN)/libOSspecific.o \
+    -lz \
+    -L$(WM_THIRD_PARTY_DIR)/packages/system/lib \
+    -ldl \
+    -lpsapi \
+    -lpthread
+else
 LIB_LIBS = $(PLIBS)\
     $(FOAM_LIBBIN)/libOSspecific.o \
     -lz
+endif
 
 $(OBJECTS_DIR)/global.o: FORCE
 

src/foam/db/dlLibraryTable/dlLibraryTable.C

@@ -76,6 +76,12 @@ bool Foam::dlLibraryTable::open(const fileName& functionLibName)
             functionLibPtr =
                 dlopen(lName.c_str(), RTLD_LAZY|RTLD_GLOBAL);
         }
+#elif defined mingw
+        if(!functionLibPtr && functionLibName.ext()=="so") {
+            fileName lName=functionLibName.lessExt()+".dll";
+            functionLibPtr =
+                dlopen(lName.c_str(), RTLD_LAZY|RTLD_GLOBAL);
+        }
 #endif
         if (!functionLibPtr)
         {

src/foam/include/OSspecific.H

@@ -49,7 +49,11 @@ namespace Foam
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
 //- Return the PID of this process
+#ifdef mingw
+int pid();
+#else
 pid_t pid();
+#endif
 
 //- Return the parent PID of this process
 pid_t ppid();

src/foam/primitives/bools/Switch/Switch.C

@@ -46,7 +46,7 @@ const char* Foam::Switch::names[Foam::Switch::INVALID+1] =
 
 Foam::Switch::switchType Foam::Switch::asEnum(const bool b)
 {
-    return b ? Switch::TRUE : Switch::FALSE;
+    return b ? Switch::FOAM_TRUE : Switch::FOAM_FALSE;
 }
 
 
@@ -122,7 +122,7 @@ bool Foam::Switch::asBool
 
 const char* Foam::Switch::asText(const bool b)
 {
-    return b ? names[Switch::TRUE] : names[Switch::FALSE];
+    return b ? names[Switch::FOAM_TRUE] : names[Switch::FOAM_FALSE];
 }
 
 

src/foam/primitives/bools/Switch/Switch.H

@@ -75,7 +75,7 @@ public:
         //  These also correspond to the entries in names.
         enum switchType
         {
-            FALSE = 0,  TRUE  = 1,
+            FOAM_FALSE = 0,  FOAM_TRUE  = 1,
             OFF   = 2,  ON    = 3,
             NO    = 4,  YES   = 5,
             NO_1  = 6,  YES_1 = 7,
@@ -127,7 +127,7 @@ public:
         //- Construct null as false
         Switch()
         :
-            switch_(Switch::FALSE)
+            switch_(Switch::FOAM_FALSE)
         {}
 
         //- Construct from bool
@@ -178,7 +178,7 @@ public:
         //- Assignment from bool
         const Switch& operator=(const bool b)
         {
-            switch_ = (b ? Switch::TRUE : Switch::FALSE);
+            switch_ = (b ? Switch::FOAM_TRUE : Switch::FOAM_FALSE);
             return *this;
         }
 

src/foam/primitives/hashes/Hash/Hash.H

@@ -33,6 +33,8 @@ Description
 #ifndef Hash_H
 #define Hash_H
 
+#include <inttypes.h>
+
 #include "label.H"
 #include "uLabel.H"
 #include "Hasher.H"
@@ -71,7 +73,7 @@ public:
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
 //- Hash specialization for hashing pointer addresses.
-//  Treat a pointer like a long.
+//  Treat a pointer like a intptr_t.
 //  This should work for both 32-bit and 64-bit pointers.
 template<>
 class Hash<void*>
@@ -83,12 +85,12 @@ public:
 
     unsigned operator()(const void* const& p, unsigned seed) const
     {
-        return Hash<long>()(long(p), seed);
+        return Hash<intptr_t>()(intptr_t(p), seed);
     }
 
     unsigned operator()(const void* const& p) const
     {
-        return Hash<long>()(long(p));
+        return Hash<intptr_t>()(intptr_t(p));
     }
 
 };

src/foam/primitives/ints/label/label.H

@@ -56,6 +56,8 @@ Description
 # define FOAM_LABEL_MAX INT_MAX
 
 # include "int.H"
+# include "long.H"
+# include "longLong.H"
 
 namespace Foam
 {

src/foam/primitives/random/Random.C

@@ -25,6 +25,10 @@ License
 
 #include "Random.H"
 
+#ifdef mingw
+#include "rand48.h"
+#endif
+
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
 namespace Foam

src/fvAgglomerationMethods/MGridGenGamgAgglomeration/Make/options

@@ -1,10 +1,20 @@
-ParMGridGen = $(WM_THIRD_PARTY_DIR)/ParMGridGen-1.0
+ParMGridGen = $(WM_THIRD_PARTY_DIR)/packages/ParMGridGen-1.0
 
 TYPE_REAL=
 #if defined(WM_SP)
 TYPE_REAL=-DTYPE_REAL
 #endif
 
+ifeq ($(WM_ARCH_BASE), mingw)
+EXE_INC = \
+    -I$(LIB_SRC)/finiteVolume/lnInclude \
+    -I$(PARMGRIDGEN_INCLUDE_DIR) \
+    $(TYPE_REAL)
+
+LIB_LIBS = \
+    -lfiniteVolume \
+    -L$(PARMGRIDGEN_LIB_DIR) -lmgrid
+else
 EXE_INC = \
     -I$(LIB_SRC)/finiteVolume/lnInclude \
     -I$(PARMGRIDGEN_INCLUDE_DIR)/Lib    \
@@ -13,3 +23,6 @@ EXE_INC = \
 
 LIB_LIBS = \
     -L$(PARMGRIDGEN_LIB_DIR) -lMGridGen
+endif
+
+

src/mesh/cfMesh/Make/options

@@ -10,6 +10,7 @@
 
 EXE_INC = \
     $(OMP_FLAGS) \
-    -I$(LIB_SRC)/triSurface/lnInclude \
-    -I$(LIB_SRC)/edgeMesh/lnInclude \
     -I$(LIB_SRC)/meshTools/lnInclude
+
+LIB_LIBS = \
+    -lmeshTools

src/meshTools/Make/options

@@ -2,16 +2,16 @@ ifneq ($(FLEX_DIR), "")
 EXE_INC = \
     -I$(FLEX_DIR)/include \
     -I$(LIB_SRC)/meshTools/lnInclude \
-    -I$(WM_THIRD_PARTY_DIR)/zlib-1.2.3
+    -I$(WM_THIRD_PARTY_DIR)/zlib-1.2.3 \
+    -I$(LIB_SRC)/decompositionMethods/decompositionMethods/lnInclude \
+    -I$(LIB_SRC)/lagrangian/basic/lnInclude
 else
 EXE_INC = \
     -I$(LIB_SRC)/meshTools/lnInclude \
-    -I$(WM_THIRD_PARTY_DIR)/zlib-1.2.3
+    -I$(WM_THIRD_PARTY_DIR)/zlib-1.2.3 \
-endif
-
-EXE_INC = \
     -I$(LIB_SRC)/decompositionMethods/decompositionMethods/lnInclude \
     -I$(LIB_SRC)/lagrangian/basic/lnInclude
+endif
 
 LIB_LIBS = \
     -ldecompositionMethods \

src/meshTools/triSurface/octreeData/octreeDataTriSurfaceTreeLeaf.H

@@ -45,7 +45,7 @@ namespace Foam
 // Forward declaration of classes
 class octreeDataTriSurface;
 
-template<>
+template<> inline
 bool treeLeaf<octreeDataTriSurface>::findNearest
 (
     const octreeDataTriSurface& shapes,

src/sampling/Make/options

@@ -8,3 +8,4 @@ LIB_LIBS = \
     -lfiniteVolume \
     -lmeshTools \
     -lsurfMesh \
+    -llagrangian

src/thermophysicalModels/basic/Make/options

@@ -3,4 +3,5 @@ EXE_INC = \
     -I$(LIB_SRC)/thermophysicalModels/specie/lnInclude
 
 LIB_LIBS = \
+    -lspecie \
     -lfiniteVolume

src/thermophysicalModels/liquidMixture/Make/options

@@ -4,3 +4,7 @@ EXE_INC = \
     -I$(LIB_SRC)/thermophysicalModels/liquids/lnInclude \
     -I$(LIB_SRC)/thermophysicalModels/combustion/lnInclude \
     -I$(LIB_SRC)/thermophysicalModels/thermophysicalFunctions/lnInclude
+
+LIB_LIBS = \
+    -lspecie \
+    -lliquids

src/thermophysicalModels/liquids/Make/options

@@ -1 +1,5 @@
-EXE_INC = -I$(LIB_SRC)/thermophysicalModels/thermophysicalFunctions/lnInclude
+EXE_INC = \
+    -I$(LIB_SRC)/thermophysicalModels/thermophysicalFunctions/lnInclude
+
+LIB_LIBS = \
+    -lthermophysicalFunctions

src/thermophysicalModels/radiation/Make/options

@@ -4,4 +4,5 @@ EXE_INC = \
 
 LIB_LIBS = \
     -lfiniteVolume \
+    -lbasicThermophysicalModels \
     -lspecie

src/thermophysicalModels/reactionThermo/Make/options

@@ -12,4 +12,6 @@ EXE_INC = \
 endif
 
 LIB_LIBS = \
-    -lfiniteVolume
+    -lbasicThermophysicalModels \
+    -lfiniteVolume \
+    -lspecie

src/thermophysicalModels/solidMixture/Make/options

@@ -1,2 +1,5 @@
 EXE_INC = \
     -I${LIB_SRC}/thermophysicalModels/solids/lnInclude
+
+LIB_LIBS = \
+    -lsolids

wmake/Makefile

@@ -92,6 +92,9 @@ LIB             = libNULL
 ifeq ($(WM_ARCH_BASE),darwin)
 # Using Mac OSX
 SO              = dylib
+else ifeq ($(WM_ARCH_BASE),mingw)
+# Using MinGW-w64 compiler on Windows
+SO              = dll
 else
 SO              = so
 endif
@@ -166,6 +169,12 @@ $(SEXE): $(OBJECTS)
 # define link statements for libraries
 #------------------------------------------------------------------------------
 
+ifneq (,$(findstring libfoam,$(LIB)))
+EXTRA_LIBS=
+else
+EXTRA_LIBS=-lfoam
+endif
+
 libso:   $(LIB).$(SO)
 	     @echo \'$(LIB).$(SO)\' is up to date.
 
@@ -175,6 +184,9 @@ $(LIB).$(SO): $(OBJECTS)
 ifeq ($(WM_ARCH_BASE),darwin)
 	     @cd $(OBJECTS_DIR) ; \
 	     $(LINKLIBSO) $(LOCAL_OBJECTS) -L$(LIB_WM_OPTIONS_DIR) $(LIB_LIBS) $(GLIB_LIBS) -install_name $(notdir $(LIB)).$(SO) -o $(LIB).$(SO)
+else ifeq ($(WM_ARCH_BASE),mingw)
+	     @cd $(OBJECTS_DIR) ; \
+	     $(LINKLIBSO) $(LOCAL_OBJECTS) -L$(LIB_WM_OPTIONS_DIR) $(LIB_LIBS) $(GLIB_LIBS) $(EXTRA_LIBS) -o $(LIB).$(SO) -Wl,--out-implib,$(LIB).a
 else
 	     @cd $(OBJECTS_DIR) ; \
 	     $(LINKLIBSO) $(LOCAL_OBJECTS) -L$(LIB_WM_OPTIONS_DIR) $(LIB_LIBS) $(GLIB_LIBS) -o $(LIB).$(SO)

wmake/rules/MINGW32_NT-6.1Gcc/ARCHITECTURE_TESTED

@@ -0,0 +1,2 @@
+by bgschaid. 2010-10-06 on Centos 5.5 with gcc 4.1
+

wmake/rules/MINGW32_NT-6.1Gcc/X

@@ -0,0 +1,3 @@
+XFLAGS     =
+XINC       = $(XFLAGS) -I/usr/X11R6/include
+XLIBS      = -L/usr/X11R6/lib64 -lXext -lX11

wmake/rules/MINGW32_NT-6.1Gcc/c

@@ -0,0 +1,16 @@
+.SUFFIXES: .c .h
+
+cWARN        = -Wall
+
+cc          = gcc
+
+include $(RULES)/c$(WM_COMPILE_OPTION)
+
+cFLAGS      = $(GFLAGS) $(cWARN) $(cOPT) $(cDBUG) $(LIB_HEADER_DIRS) -fPIC
+
+ctoo        = $(WM_SCHEDULER) $(cc) $(cFLAGS) -c $$SOURCE -o $@
+
+LINK_LIBS   = $(cDBUG)
+
+LINKLIBSO   = $(cc) -shared
+LINKEXE     = $(cc) -Xlinker --add-needed -Xlinker -z -Xlinker nodefs

wmake/rules/MINGW32_NT-6.1Gcc/c++

@@ -0,0 +1,22 @@
+.SUFFIXES: .C .cxx .cc .cpp
+
+c++WARN     = -Wall -Wextra -Wno-unused-parameter -Wold-style-cast -Wnon-virtual-dtor
+
+CC          = g++
+
+include $(RULES)/c++$(WM_COMPILE_OPTION)
+
+ptFLAGS     = -DNoRepository -ftemplate-depth-200
+
+GFLAGS     = -DWM_$(WM_PRECISION_OPTION)
+c++FLAGS    = $(GFLAGS) $(c++WARN) $(c++OPT) $(c++DBUG) $(ptFLAGS) $(LIB_HEADER_DIRS) -I$(OPENMPI_DIR)/include -I$(WM_THIRD_PARTY_DIR)/packages/system/include -Dmingw -DBIG_ENDIAN=0 -DLITTLE_ENDIAN=1 -DBYTE_ORDER=BIG_ENDIAN
+
+Ctoo        = $(WM_SCHEDULER) $(CC) $(c++FLAGS) -c $$SOURCE -o $@
+cxxtoo      = $(Ctoo)
+cctoo       = $(Ctoo)
+cpptoo      = $(Ctoo)
+
+LINK_LIBS   = $(c++DBUG) -L$(OPENMPI_DIR)/lib -lmpi -lpthread -lz -L$(WM_THIRD_PARTY_DIR)/packages/system/lib -ldl -lpsapi
+
+LINKLIBSO   = $(CC) $(c++FLAGS) -shared -Xlinker --add-needed -Xlinker --no-as-needed
+LINKEXE     = $(CC) $(c++FLAGS) -Xlinker --add-needed -Xlinker --no-as-needed $(FOAM_LIBBIN)/libOSspecific.o

wmake/rules/MINGW32_NT-6.1Gcc/c++Debug

@@ -0,0 +1,2 @@
+c++DBUG    = -ggdb3 -DFULLDEBUG
+c++OPT      = -O0 -fdefault-inline

wmake/rules/MINGW32_NT-6.1Gcc/c++Opt

@@ -0,0 +1,4 @@
+c++DBUG     =
+c++OPT      = -O3
+#c++OPT      = -march=nocona -O3
+# -ftree-vectorize -ftree-vectorizer-verbose=3

wmake/rules/MINGW32_NT-6.1Gcc/c++Prof

@@ -0,0 +1,2 @@
+c++DBUG    = -pg
+c++OPT     = -O2

wmake/rules/MINGW32_NT-6.1Gcc/cDebug

@@ -0,0 +1,2 @@
+cDBUG       = -ggdb -DFULLDEBUG
+cOPT        = -O1 -fdefault-inline -finline-functions

wmake/rules/MINGW32_NT-6.1Gcc/cOpt

@@ -0,0 +1,2 @@
+cDBUG       =
+cOPT        = -O3

wmake/rules/MINGW32_NT-6.1Gcc/cProf

@@ -0,0 +1,2 @@
+cDBUG       = -pg
+cOPT        = -O2

wmake/rules/MINGW32_NT-6.1Gcc/general

@@ -0,0 +1,11 @@
+CPP        = cpp -traditional-cpp
+LD         = ld
+
+PROJECT_LIBS = -l$(WM_PROJECT) -liberty
+
+include $(GENERAL_RULES)/standard
+
+include $(RULES)/X
+include $(RULES)/c
+include $(RULES)/c++
+include $(RULES)/nvcc

wmake/rules/MINGW32_NT-6.1Gcc/mplib

@@ -0,0 +1,3 @@
+PFLAGS     =
+PINC       =
+PLIBS      =

wmake/rules/MINGW32_NT-6.1Gcc/mplibGAMMA

@@ -0,0 +1,3 @@
+PFLAGS     =
+PINC       = -I$(MPI_ARCH_PATH)/include
+PLIBS      = -L$(MPI_ARCH_PATH)/lib -lgamma

wmake/rules/MINGW32_NT-6.1Gcc/mplibHPMPI

@@ -0,0 +1,3 @@
+PFLAGS     =
+PINC       = -I$(MPI_ARCH_PATH)/include -D_MPICC_H
+PLIBS      = -L$(MPI_ARCH_PATH)/lib/linux_amd64 -lmpi

wmake/rules/MINGW32_NT-6.1Gcc/mplibMPICH

@@ -0,0 +1,3 @@
+PFLAGS     =
+PINC       = -I$(MPI_ARCH_PATH)/include
+PLIBS      = -L$(MPI_ARCH_PATH)/lib -lmpich